JZ-IV-10

{{Short description|Chemical compound}}

{{primary sources|date=June 2013}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451228350

| IUPAC_name = (+)-2-([(3R,4S)-1-methyl-4-(4-chlorophenyl)piperidin-3-yl]methylthio)-N-isopropylacetamide

| image = JZ-IV-10 chemical structure.png

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|CAS}}

| CAS_number = 807342-16-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GYT6ACY5JL

| ATC_prefix =

| ATC_suffix =

| PubChem = 11291199

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 9466185

| C=18 | H=27 | Cl=1 | N=2 | O=1 | S=1

| smiles = Clc1ccc(cc1)[C@H]2CCN(C)C[C@@H]2CSCC(=O)NC(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H27ClN2OS/c1-13(2)20-18(22)12-23-11-15-10-21(3)9-8-17(15)14-4-6-16(19)7-5-14/h4-7,13,15,17H,8-12H2,1-3H3,(H,20,22)/t15-,17-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = GPNABXAHBDYHFE-NVXWUHKLSA-N

}}

JZ-IV-10 is a piperidine derivative related to cocaine which acts as a highly potent serotonin–norepinephrine–dopamine reuptake inhibitor (also called SNDRI, or triple reuptake inhibitor).{{cite patent|country=WO|number=2005041875|title=Dopamine-, norepinephrine- and serotonin- transporter- selective heterocyclic compounds and their therapeutic applications|pubdate=2005-05-12|assign=Georgetown University|inventor1-last= Kozikowski|inventor1-first=Alan P.

|inventor2-last=Zhou|inventor2-first=Jia}} The eugeroic modafinil was used as a lead to fuel this compound's discovery.{{cite journal | vauthors = Zhou J, He R, Johnson KM, Ye Y, Kozikowski AP | title = Piperidine-based nocaine/modafinil hybrid ligands as highly potent monoamine transporter inhibitors: efficient drug discovery by rational lead hybridization | journal = Journal of Medicinal Chemistry | volume = 47 | issue = 24 | pages = 5821–4 | date = November 2004 | pmid = 15537337 | pmc = 1395211 | doi = 10.1021/jm040117o }}{{cite journal | vauthors = He R, Kurome T, Giberson KM, Johnson KM, Kozikowski AP | title = Further structure-activity relationship studies of piperidine-based monoamine transporter inhibitors: effects of piperidine ring stereochemistry on potency. Identification of norepinephrine transporter selective ligands and broad-spectrum transporter inhibitors | journal = Journal of Medicinal Chemistry | volume = 48 | issue = 25 | pages = 7970–9 | date = December 2005 | pmid = 16335921 | doi = 10.1021/jm050694s }}