Josamycin

{{short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{More citations needed|date=April 2021}}{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 477496532

| IUPAC_name = (2S,3S,4R,6S)-6-{[(2R,3S,4R,5R,6S)-6-{[(4R,5S,6S,7R,9R,10R,11E,13E,16R)-4-Acetoxy-10-hydroxy-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)oxacyclohexadeca-11,13-dien-6-yl]oxy}-4-(dimethylamino)-5-hydro xy-2-methyltetrahydro-2H-pyran-3-yl]oxy}-4-hydroxy-2,4-dimethyltetrahydro-2H-pyran-3-yl 3-methylbutanoate

| image = Josamycin.png

| image2 = Josamycin ball-and-stick.png

| tradename =

| Drugs.com = {{drugs.com|international|josamycin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 16846-24-5

| ATC_prefix = J01

| ATC_suffix = FA07

| PubChem = 5282165

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01321

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4445361

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HV13HFS217

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01235

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 31739

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 224436

| PDB_ligand =

| C=42 | H=69 | N=1 | O=15

| smiles = C[C@@H]1C/C=C/C=C/[C@@H]([C@@H](C[C@@H]([C@@H]([C@H]([C@@H](CC(=O)O1)OC(=O)C)OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C)O[C@H]3C[C@@]([C@H]([C@@H](O3)C)OC(=O)CC(C)C)(C)O)N(C)C)O)CC=O)C)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C42H69NO15/c1-23(2)19-32(47)56-40-27(6)53-34(22-42(40,8)50)57-37-26(5)54-41(36(49)35(37)43(9)10)58-38-29(17-18-44)20-24(3)30(46)16-14-12-13-15-25(4)52-33(48)21-31(39(38)51-11)55-28(7)45/h12-14,16,18,23-27,29-31,34-41,46,49-50H,15,17,19-22H2,1-11H3/b13-12+,16-14+/t24-,25-,26-,27+,29+,30+,31-,34+,35-,36-,37-,38+,39+,40+,41+,42-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XJSFLOJWULLJQS-NGVXBBESSA-N

}}

Josamycin is a macrolide antibiotic. It was isolated by Hamao Umezawa and his colleagues from strains of Streptomyces narbonensis var. josamyceticus var. nova in 1964.{{cite journal | vauthors = Osono T, Oka Y, Watanabe S, Okami Y, Umezawa H | title = A new antibiotic, josamyicn. I. Isolation and physico-chemical characteristics | journal = The Journal of Antibiotics | volume = 20 | issue = 3 | pages = 174–180 | date = July 1967 | pmid = 6072798 }}{{cite journal | vauthors = Umezawa H | title = Discovery of josamycin | journal = Giornale Italiano di Chemioterapia | volume = 29 | pages = 1–10 | date = 1982 | issue = Suppl 1 | pmid = 6765367 }}

It is currently sold in various countries.Brand examples are:

• Europe: Josalid, Josacine, Iosalide, Josamina
• Russia: Wilprafen (Вильпрафен)
• Japan: Josamy