K-selectride
{{Chembox
| ImageFile = K-selectride.svg
| ImageSize =
| ImageAlt =
| IUPACName =
| OtherNames = potassium Tri-sec-butylborohydride
|Section1={{Chembox Identifiers
| CASNo = 54575-49-4
| ChemSpiderID = 3509885
| EINECS = 259-241-7
| PubChem = 23712865
| UNII = 6HK5NKZ8D3
| StdInChI=1S/C12H27B.K/c1-7-10(4)13(11(5)8-2)12(6)9-3;/h10-12H,7-9H2,1-6H3;/q-1;+1
| StdInChIKey = NHYQAKNGPZLNOH-UHFFFAOYSA-N
| SMILES = [B-](C(C)CC)(C(C)CC)C(C)CC.[K+]
}}
|Section2={{Chembox Properties
| C=12|H=28|B=1|K=1
| MolarMass =
| Appearance = colorless solid (sold as a solution)
| Density =
| MeltingPt =
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
K-selectride is the organoboron compound with the formula {{chem2|KBH(C4H9)3}}. It is the potassium salt of tri(sec-butyl)borohydride. The compound is sold as solution in THF. It is a strong reducing agent. Solutions are pyrophoric and highly reactive toward water and protic compounds. It is handled using air-free technique. It is produced by the reaction of tri(sec-butyl)borane with potassium hydride. The reagent is used to reduce ketones to alcohols.{{cite book |doi=10.1002/047084289X.rp253 |chapter=Potassium Tri- sec -butylborohydride |title=Encyclopedia of Reagents for Organic Synthesis |date=2001 |last1=Hubbard |first1=John L. |isbn=0-471-93623-5 }}
Related compounds
- Lithium trisiamylborohydride{{cite book |doi=10.1002/047084289X.rl151|chapter=Lithium Trisiamylborohydride|first1=Marek|last1=Zaidlewicz|first2=Herbert C. |last2=Brown|year=2001|title=Encyclopedia of Reagents for Organic Synthesis (EROS) |isbn=0-471-93623-5 }}
- Lithium triethylborohydride ("Super hydride")
- L-selectride {{chem2|Li[(CH3CH2CH(CH3))3BH]}}