K-selectride

{{Chembox

| ImageFile = K-selectride.svg

| ImageSize =

| ImageAlt =

| IUPACName =

| OtherNames = potassium Tri-sec-butylborohydride

|Section1={{Chembox Identifiers

| CASNo = 54575-49-4

| ChemSpiderID = 3509885

| EINECS = 259-241-7

| PubChem = 23712865

| UNII = 6HK5NKZ8D3

| StdInChI=1S/C12H27B.K/c1-7-10(4)13(11(5)8-2)12(6)9-3;/h10-12H,7-9H2,1-6H3;/q-1;+1

| StdInChIKey = NHYQAKNGPZLNOH-UHFFFAOYSA-N

| SMILES = [B-](C(C)CC)(C(C)CC)C(C)CC.[K+]

}}

|Section2={{Chembox Properties

| C=12|H=28|B=1|K=1

| MolarMass =

| Appearance = colorless solid (sold as a solution)

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

K-selectride is the organoboron compound with the formula {{chem2|KBH(C4H9)3}}. It is the potassium salt of tri(sec-butyl)borohydride. The compound is sold as solution in THF. It is a strong reducing agent. Solutions are pyrophoric and highly reactive toward water and protic compounds. It is handled using air-free technique. It is produced by the reaction of tri(sec-butyl)borane with potassium hydride. The reagent is used to reduce ketones to alcohols.{{cite book |doi=10.1002/047084289X.rp253 |chapter=Potassium Tri- sec -butylborohydride |title=Encyclopedia of Reagents for Organic Synthesis |date=2001 |last1=Hubbard |first1=John L. |isbn=0-471-93623-5 }}