Kitasamycin

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424731909

| IUPAC_name = [(4R,5S,6S,7R,9R,10R,11E,13E,16R)-6-{[(2S,3R,4R,5S,6R)-5-{[(2S,4R,5S,6S)-4,5-Dihydroxy-4,6-dimethyltetrahydro-2H-pyran-2-yl]oxy}-4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-4,10-dihydroxy-5-methoxy-9,16-dimethyl-2-oxooxacyclohexadeca-11,13-dien-7-yl]acetaldehyde (non-preferred name)

| image = kitasamycin.png

| tradename =

| Drugs.com = {{drugs.com|international|kitasamycin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 22875-15-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = VW9SY2S5WL

| ATCvet = yes

| ATC_prefix = J01

| ATC_suffix = FA93

| ATC_supplemental =

| PubChem = 5282189

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1909061

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4445382

| chemical_formula =

| C=35 | H=59 | N=1 | O=13

| synonyms = Turimycin

| smiles = C[C@@H]1C/C=C/C=C/[C@@H]([C@@H](C[C@@H]([C@@H]([C@H]([C@@H](CC(=O)O1)O)OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C)O[C@H]3C[C@@]([C@H]([C@@H](O3)C)O)(C)O)N(C)C)O)CC=O)C)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C35H59NO13/c1-19-16-23(14-15-37)31(32(44-8)25(39)17-26(40)45-20(2)12-10-9-11-13-24(19)38)49-34-29(41)28(36(6)7)30(21(3)47-34)48-27-18-35(5,43)33(42)22(4)46-27/h9-11,13,15,19-25,27-34,38-39,41-43H,12,14,16-18H2,1-8H3/b10-9+,13-11+/t19-,20-,21-,22+,23+,24+,25-,27+,28-,29-,30-,31+,32+,33+,34+,35-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XYJOGTQLTFNMQG-KJHBSLKPSA-N

}}

Kitasamycin (INN) is a macrolide antibiotic. It is produced by Streptomyces kitasatoensis.{{cite journal | vauthors = Zheng Q, Gao S | title = The effect of surfactant on fermentation of kitasamycin in Streptomyces kitasatoensis | journal = Biotechnology and Applied Biochemistry | volume = 63 | issue = 6 | pages = 895–900 | date = November 2016 | pmid = 26339801 | doi = 10.1002/bab.1443 | s2cid = 7290695 }} The drug has antimicrobial activity against a wide spectrum of pathogens. There are several generic names of this drug such as:{{cite web | title = Kitasamycin | url = https://www.drugs.com/international/kitasamycin.html | archive-url = https://web.archive.org/web/20121020200912/https://www.drugs.com/international/kitasamycin.html | archive-date = 20 October 2012 | work = Drugs.com }}

• Kitasamycin (OS: BAN, JAN, USAN)
• Kitasamycine (OS: DCF)
• C 637 (IS)
• Katasamycin (IS)
• Leucomycin (IS)
• Kitasamycin (PH: JP XV)
• Kitasamycin Acetate (OS: JAN)
• Leucomycin Acetate (IS)
• Kitasamycin Acetate (PH: JP XV)
• Kitasamycin Tartrate (OS: JAN)
• Leucomycin Tartrate (IS)
• Kitasamycin Tartrate (PH: JP XV)