Kukoamines

{{Chembox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| Name = Kukoamine A

| Reference = {{PubChem|5318865}}

| ImageFile = Kukoamine A Structure.svg

| ImageFile1 = Kukoamines structure 3d.png

| ImageAlt = 2D Structure

| ImageName1 = Kukoamines 3D structure

| ImageAlt1 = Kukoamines 3D structure

| ImageName = Kukoamines 2D structure

| PIN = 3-(3,4-Dihydroxyphenyl)-N-[3-[4-[3-[3-(3,4-dihydroxyphenyl)propanoylamino]propylamino]butylamino]propyl]propanamide

| SystematicName =

| OtherNames = N(1),N(12)-bis(dihydrocaffeoyl)spermine
AC1NSXD9
BDBM50240622
DNC013917
C17615

| IUPACName =

| Section1 = {{Chembox Identifiers

| SMILES = C1=CC(=C(C=C1CCC(=O)NCCCNCCCCNCCCNC(=O)CCC2=CC(=C(C=C2)O)O)O)O

| StdInChI = 1S/C28H42N4O6/c33-23-9-5-21(19-25(23)35)7-11-27(37)31-17-3-15-29-13-1-2-14-30-16-4-18-32-28(38)12-8-22-6-10-24(34)26(36)20-22/h5-6,9-10,19-20,29-30,33-36H,1-4,7-8,11-18H2,(H,31,37)(H,32,38)

| StdInChIKey = IOLDDENZPBFBHV-UHFFFAOYSA-N

| CASNo = 75288-96-9

| PubChem = 5318865

| ChemSpiderID = 4477322

| ChEBI = 81220

| KEGG = C17615

| ChEMBL = 79129

}}

| Section2 = {{Chembox Properties

| C=28|H=42|N=4|O=6

}}

| Section3 =

| Section4 =

| Section5 =

| Section6 =

}}

Kukoamines are chemicals that are present in some plants including Lycium chinense, potatoes, and tomatoes.{{Cite book|url=https://books.google.com/books?id=d42RCwAAQBAJ&q=Kukoamines+sleeping+sickness&pg=PA27|title=Edible Medicinal and Non-Medicinal Plants: Volume 12 Modified Stems, Roots, Bulbs|last=Lim|first=T. K.|date=2016-02-11|publisher=Springer|isbn=9783319260655|language=en}}{{cite web|url=http://www.cabi.org/nutrition/news/14477|publisher=cabi.org|title=Kukoamines Found in Potatoes|access-date=2017-04-07}}{{cite journal | doi = 10.1021/jf050298i| pmid = 15969534| title = Dihydrocaffeoyl Polyamines (Kukoamine and Allies) in Potato (Solanum tuberosum) Tubers Detected during Metabolite Profiling| journal = Journal of Agricultural and Food Chemistry| volume = 53| issue = 13| pages = 5461–6| year = 2005| last1 = Parr| first1 = Adrian J.| last2 = Mellon| first2 = Fred A.| last3 = Colquhoun| first3 = Ian J.| last4 = Davies| first4 = Howard V.}} The most prevalent example is kukoamine A; others include kukoamine B, C, and D.{{PubChem|10346914}}, entry for kukoamine B{{PubChem|10052730}}, entry for kukoamine C{{PubChem|10075692}}, entry for kukoamine D

Chemically, kukoamines are catechols and also dihydrocaffeic acid derivatives of polyamines.