L-759,656

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424761085

| IUPAC_name = (6aR,10aR)-1-methoxy-6,6-dimethyl-9-methylidene-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene

| image = L-759,656 Structure.svg

| image_class = skin-invert-image

| width = 240

| tradename =

| legal_status =

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 174627-56-6

| PubChem = 5311216

| IUPHAR_ligand = 749

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 294013

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4470735

| C=26 | H=40 | O=2

| smiles = CCCCCCC(C)(C)c1cc2c(c(c1)OC)[C@@H]3CC(=C)CC[C@H]3C(O2)(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C26H40O2/c1-8-9-10-11-14-25(3,4)19-16-22(27-7)24-20-15-18(2)12-13-21(20)26(5,6)28-23(24)17-19/h16-17,20-21H,2,8-15H2,1,3-7H3/t20-,21-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BJIIKHXAZBTGLF-NHCUHLMSSA-N

}}

L-759,656 is an analgesic drug that is a cannabinoid agonist. It is a highly selective agonist for the CB₂ receptor, with selectivity of 414x for CB₂ over CB₁,{{cite journal | vauthors = Ross RA, Brockie HC, Stevenson LA, Murphy VL, Templeton F, Makriyannis A, Pertwee RG | title = Agonist-inverse agonist characterization at CB1 and CB2 cannabinoid receptors of L759633, L759656, and AM630 | journal = British Journal of Pharmacology | volume = 126 | issue = 3 | pages = 665–72 | date = February 1999 | pmid = 10188977 | pmc = 1565857 | doi = 10.1038/sj.bjp.0702351 | authorlink6 = Alexandros Makriyannis }} although it is still not as selective as newer agents such as HU-308.

It produces some similar effects to other cannabinoid agonists such as analgesia, but with little or no sedative or psychoactive effects due to its weak CB₁ activity, and a relatively strong antiinflammatory effect due to its strong activity at CB₂.{{cite journal | vauthors = Huffman JW | title = The search for selective ligands for the CB2 receptor | journal = Current Pharmaceutical Design | volume = 6 | issue = 13 | pages = 1323–37 | date = September 2000 | pmid = 10903395 | doi = 10.2174/1381612003399347 }}{{cite journal | vauthors = Huffman JW | title = CB2 receptor ligands | journal = Mini Reviews in Medicinal Chemistry | volume = 5 | issue = 7 | pages = 641–9 | date = July 2005 | pmid = 16026310 | doi = 10.2174/1389557054368844 }}