L-Arginine L-pyroglutamate

{{one source|date=December 2013}}

{{DISPLAYTITLE:L-Arginine L-pyroglutamate}}

{{Chembox

| Name ={{sm|l}}-Arginine {{sm|l}}-pyroglutamate

| ImageFileL1 = L-Arginine-L-pyroglutamate.png

| ImageNameL1 = Arginine Pyroglutamate

| ImageFileR1 = L-Arginine-L-pyroglutamate_3D.png

| ImageNameR1 = Arginine Pyroglutamate

| IUPACName = (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;

(2S)-5-oxopyrrolidine-2-carboxylic acid (1:1)

| OtherNames =

|Section1={{Chembox Identifiers

| InChI = 1/C6H14N4O2.C5H7NO3/c7-4(5(11)12)2-1-3-10-6(8)9;7-4-2-1-3(6-4)5(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2H2,(H,6,7)(H,8,9)/t4-;/m0./s1

| InChIKey = UYCAGRPOUWSBIQ-WCCKRBBIBE

| CASNo = 56265-06-6

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 808T94CEU6

| PubChem = 198346

| ChemSpiderID = 4957262

| EINECS = 260-081-5

| SMILES = O=C(O)C1NC(=O)CC1.O=C(O)[C@@H](N)CCC/N=C(\N)N

}}

|Section2={{Chembox Properties

| C=11 | H=21 | N=5 | O=5

| Appearance = white powder

| Density = solid

| MeltingPtC = 210

| MeltingPt_notes =

| BoilingPt =

| Solubility = soluble }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPtC = 201.2

| AutoignitionPtC =

}}

}}

{{sm|l}}-Arginine {{sm|l}}-pyroglutamate, also known as pirglutargine and arginine pidolate, is the L-arginine salt of pyroglutamic acid. Arginine pyroglutamate is a delivery form of arginine.