LPD-824

{{short description|Chemical compound}}

{{refimprove|date=December 2009}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 415673871

| IUPAC_name = (8β)-6-Methyl-8-(pyrrolidin-1-ylcarbonyl)-9,10-didehydroergoline

| image = LPD-824-2d-skeletal.svg

| alt = A chemical diagram of LPD-824

| tradename =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| routes_of_administration = Oral

| metabolism = Hepatic

| excretion = Renal

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 2385-87-7

| PubChem = 200628

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 173678

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 302524

| C = 20

| H = 23

| N = 3

| O = 1

| smiles = O=C(N1CCCC1)[C@@H]4C=C3c5cccc2c5c(c[nH]2)C[C@H]3N(C4)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H23N3O/c1-22-12-14(20(24)23-7-2-3-8-23)9-16-15-5-4-6-17-19(15)13(11-21-17)10-18(16)22/h4-6,9,11,14,18,21H,2-3,7-8,10,12H2,1H3/t14-,18-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SETDYMMXQQXCRP-RDTXWAMCSA-N

| synonyms = LPD-824, N-Pyrrolidyl-lysergamide

}}

N-Pyrrolidyllysergamide (LPD-824), also known as lysergic acid pyrrolidide, is a derivative of ergine. It is reported to be a serotonin receptor antagonist{{cite journal | vauthors = Dunn WJ, Bederka JP | title = The role of hydrophobicity in the antiserotonin activity of LSD analogs | journal = Research Communications in Chemical Pathology and Pharmacology | volume = 7 | issue = 2 | pages = 275–85 | date = February 1974 | pmid = 4818374 | doi = | url = }} and have some mild, short lasting LSD-like effects at a dose of 800 micrograms.{{Cite web|url=https://erowid.org/library/books_online/tihkal/tihkal26.shtml|title = Erowid Online Books : "TIHKAL" - #26 LSD-25 }}