LPK-26
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 451562149
| IUPAC_name = 2-(3,4-dichlorophenyl)-N-[(2S)-1-(2,5-dihydropyrrol-1-yl)-3-methylbutan-2-yl]-N-methylacetamide
| image = LPK-26 Structure.svg
| width =
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 492451-07-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = HTE2K3D35Y
| ATC_prefix =
| ATC_suffix =
| PubChem = 10043746
| IUPHAR_ligand =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 8219310
| C=18 | H=24 | Cl=2 | N=2 | O=1
| smiles = CC(C)[C@@H](CN1CC=CC1)N(C)C(=O)CC2=CC(=C(C=C2)Cl)Cl
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C18H24Cl2N2O/c1-13(2)17(12-22-8-4-5-9-22)21(3)18(23)11-14-6-7-15(19)16(20)10-14/h4-7,10,13,17H,8-9,11-12H2,1-3H3/t17-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = QFAIAMMFKKYCTL-QGZVFWFLSA-N
}}
LPK-26 is a potent and selective κ-opioid agonist, and has analgesic effects.{{cite journal |vauthors=Tao YM, Li QL, Zhang CF, Xu XJ, Chen J, Ju YW, Chi ZQ, Long YQ, Liu JG |title=LPK-26, a novel kappa-opioid receptor agonist with potent antinociceptive effects and low dependence potential |journal=European Journal of Pharmacology |volume=584 |issue=2–3 |pages=306–11 |date=April 2008 |pmid=18353307 |doi=10.1016/j.ejphar.2008.02.028 }}