LR132

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (+)-3,4-dichloro-N-[(1R,2S)-2-(1-pyrrolidinyl)cyclohexyl]benzeneethanamine

| image = LR132.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 135211-15-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K7C7XKK3P3

| ATC_prefix =

| ATC_suffix =

| PubChem = 5471948

| DrugBank_Ref =

| DrugBank =

| ChEMBL = 320828

| ChemSpiderID_Ref =

| ChemSpiderID = 4581994

| C=18 | H=26 | N=2 | Cl=2

| StdInChI = 1S/C18H26Cl2N2/c19-15-8-7-14(13-16(15)20)9-10-21-17-5-1-2-6-18(17)22-11-3-4-12-22/h7-8,13,17-18,21H,1-6,9-12H2/t17-,18+/m0/s1

| StdInChIKey = NREHOBGKKWFKES-ZWKOTPCHSA-N

| smiles = c1cc(c(cc1CCN[C@H]2CCCC[C@H]2N3CCCC3)Cl)Cl

}}

LR132 or (+)-3,4-dichloro-N-[(1R,2S)-2-(1-pyrrolidinyl)cyclohexyl]benzeneethanamine is a selective sigma receptor antagonist, with a reported binding affinity of K_i = 2 ± 0.1 nM for the sigma-1 receptor and more than 350 times selectivity over the sigma-2 receptor.{{cite journal |vauthors=Matsumoto RR, McCracken KA, Friedman MJ, Pouw B, De Costa BR, Bowen WD | title = Conformationally restricted analogs of BD1008 and an antisense oligodeoxynucleotide targeting sigma1 receptors produce anti-cocaine effects in mice | journal = Eur. J. Pharmacol. | volume = 419 | issue = 2-3 | pages = 163–74 | year = 2001 | pmid = 11426838| doi = 10.1016/s0014-2999(01)00968-2}}

Consistent with other reported sigma receptor antagonists, pretreating Swiss Webster mice with LR132 significantly decreases the convulsivity and lethality of cocaine.