LUF6000

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| IUPAC_name = 2-cyclohexyl-N-(3,4-dichlorophenyl)-3H-imidazo[4,5-c]quinolin-4-amine

| image = LUF6000_structure.png

| width =

| tradename =

| routes_of_administration =

| CAS_number = 890087-21-5

| ATC_prefix =

| PubChem = 11711282

| IUPHAR_ligand = 9446

| ChemSpiderID = 9886004

| UNII =

| ChEMBL = 475346

| C=22 | H=20 | Cl=2 | N=4

| smiles = C1CCC(CC1)C2=NC3=C(N2)C(=NC4=CC=CC=C43)NC5=CC(=C(C=C5)Cl)Cl

| StdInChI = 1S/C22H20Cl2N4/c23-16-11-10-14(12-17(16)24)25-22-20-19(15-8-4-5-9-18(15)26-22)27-21(28-20)13-6-2-1-3-7-13/h4-5,8-13H,1-3,6-7H2,(H,25,26)(H,27,28)

| StdInChIKey = UWJVRSIGHHSDSJ-UHFFFAOYSA-N

}}

LUF6000 is an experimental drug which acts as a positive allosteric modulator of the adenosine A3 receptor. It has no effect on A3-mediated signalling by itself, but significantly enhances the effect of A3-selective agonists or partial agonists, and can even cause some adenosine A3 antagonists to produce agonist-like signalling. It has antiinflammatory effects in animal studies.{{cite journal | vauthors = Göblyös A, Gao ZG, Brussee J, Connestari R, Santiago SN, Ye K, Ijzerman AP, Jacobson KA | title = Structure-activity relationships of new 1H-imidazo[4,5-c]quinolin-4-amine derivatives as allosteric enhancers of the A3 adenosine receptor | journal = Journal of Medicinal Chemistry | volume = 49 | issue = 11 | pages = 3354–3361 | date = June 2006 | pmid = 16722654 | pmc = 2547348 | doi = 10.1021/jm060086s }}{{cite journal | vauthors = Gao ZG, Ye K, Göblyös A, Ijzerman AP, Jacobson KA | title = Flexible modulation of agonist efficacy at the human A3 adenosine receptor by the imidazoquinoline allosteric enhancer LUF6000 | journal = BMC Pharmacology | volume = 8 | pages = 20 | date = December 2008 | pmid = 19077268 | pmc = 2625337 | doi = 10.1186/1471-2210-8-20 | doi-access = free }}{{cite journal | vauthors = Heitman LH, Göblyös A, Zweemer AM, Bakker R, Mulder-Krieger T, van Veldhoven JP, de Vries H, Brussee J, Ijzerman AP | title = A series of 2,4-disubstituted quinolines as a new class of allosteric enhancers of the adenosine A3 receptor | journal = Journal of Medicinal Chemistry | volume = 52 | issue = 4 | pages = 926–931 | date = February 2009 | pmid = 19161279 | doi = 10.1021/jm8014052 }}{{cite journal | vauthors = Gao ZG, Verzijl D, Zweemer A, Ye K, Göblyös A, Ijzerman AP, Jacobson KA | title = Functionally biased modulation of A(3) adenosine receptor agonist efficacy and potency by imidazoquinolinamine allosteric enhancers | journal = Biochemical Pharmacology | volume = 82 | issue = 6 | pages = 658–668 | date = September 2011 | pmid = 21718691 | pmc = 3152598 | doi = 10.1016/j.bcp.2011.06.017 }}{{cite journal | vauthors = Cohen S, Barer F, Bar-Yehuda S, IJzerman AP, Jacobson KA, Fishman P | title = A₃ adenosine receptor allosteric modulator induces an anti-inflammatory effect: in vivo studies and molecular mechanism of action | journal = Mediators of Inflammation | date = 2014 | volume = 2014 | pages = 708746 | pmid = 25374446 | pmc = 4211160 | doi = 10.1155/2014/708746 | doi-access = free }}{{cite journal | vauthors = Gao ZG, Chen W, Gao RR, Li J, Tosh DK, Hanover JA, Jacobson KA | title = Genetic and functional modulation by agonist MRS5698 and allosteric enhancer LUF6000 at the native A3 adenosine receptor in HL-60 cells | journal = Purinergic Signalling | volume = 20 | issue = 5 | pages = 559–570 | date = October 2024 | pmid = 38416332 | pmc = 11377395 | doi = 10.1007/s11302-024-09992-z }}

References