LY-235959

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (3S,4aR,6S,8aR)-6-(phosphonomethyl)-1,2,3,4,4a,5,6,7,8,

8a-decahydroisoquinoline-3-carboxylic acid

| image = LY-235959.svg

| width = 240

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 137433-06-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = AR2BHC0C6P

| PubChem = 131938

| ChemSpiderID = 116555

| synonyms =

| C=11 | H=20 | N=1 | O=5 | P=1

| SMILES = [H][C@]12[C@](CC[C@H](CP(O)(O)=O)C2)([H])CN[C@H](C(O)=O)C1

| StdInChI = 1S/C11H20NO5P/c13-11(14)10-4-9-3-7(6-18(15,16)17)1-2-8(9)5-12-10/h7-10,12H,1-6H2,(H,13,14)(H2,15,16,17)/t7-,8-,9+,10-/m0/s1

| StdInChIKey = STIRHCNEGQQBOY-QEYWKRMJSA-N

}}

LY-235959 is a competitive antagonist at the NMDA receptor.{{cite journal | vauthors = Allen RM, Dykstra LA | title = N-methyl-D-aspartate receptor antagonists potentiate the antinociceptive effects of morphine in squirrel monkeys | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 298 | issue = 1 | pages = 288–97 | date = July 2001 | pmid = 11408554 }} It has analgesic and neuroprotective effects and causes hypothermia in animal models,{{cite journal | vauthors = Rawls SM, Cowan A, Tallarida RJ, Geller EB, Adler MW | title = N-methyl-D-aspartate antagonists and WIN 55212-2 [4,5-dihydro-2-methyl-4(4-morpholinylmethyl)-1-(1-naphthalenyl-carbonyl)-6H-pyrrolo[3,2,1-i,j]quinolin-6-one], a cannabinoid agonist, interact to produce synergistic hypothermia | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 303 | issue = 1 | pages = 395–402 | date = October 2002 | pmid = 12235276 | doi = 10.1124/jpet.102.037473 | s2cid = 18307764 }} as well as reducing the development of tolerance to morphine and altering the reinforcing effects of cocaine.{{cite journal | vauthors = Allen RM, Carelli RM, Dykstra LA, Suchey TL, Everett CV | title = Effects of the competitive N-methyl-D-aspartate receptor antagonist, LY235959 [(-)-6-phosphonomethyl-deca-hydroisoquinoline-3-carboxylic acid], on responding for cocaine under both fixed and progressive ratio schedules of reinforcement | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 315 | issue = 1 | pages = 449–57 | date = October 2005 | pmid = 16024734 | doi = 10.1124/jpet.105.086355 | s2cid = 15151429 }}{{cite journal | vauthors = Allen RM, Dykstra LA, Carelli RM | title = Continuous exposure to the competitive N-methyl-D: -aspartate receptor antagonist, LY235959, facilitates escalation of cocaine consumption in Sprague-Dawley rats | journal = Psychopharmacology | volume = 191 | issue = 2 | pages = 341–51 | date = April 2007 | pmid = 17225167 | doi = 10.1007/s00213-006-0661-3 | s2cid = 20887004 }}{{cite journal | vauthors = Fischer BD, Ward SJ, Henry FE, Dykstra LA | title = Attenuation of morphine antinociceptive tolerance by a CB(1) receptor agonist and an NMDA receptor antagonist: Interactive effects | journal = Neuropharmacology | volume = 58 | issue = 2 | pages = 544–50 | date = February 2010 | pmid = 19699755 | pmc = 2813317 | doi = 10.1016/j.neuropharm.2009.08.005 }}{{cite journal | vauthors = Dykstra LA, Fischer BD, Balter RE, Henry FE, Schmidt KT, Miller LL | title = Opioid antinociception, tolerance and dependence: interactions with the N-methyl-D-aspartate system in mice | journal = Behavioural Pharmacology | volume = 22 | issue = 5–6 | pages = 540–7 | date = September 2011 | pmid = 21712708 | pmc = 3155647 | doi = 10.1097/FBP.0b013e328348ed08 }}{{cite journal | vauthors = Bicca MA, Figueiredo CP, Piermartiri TC, Meotti FC, Bouzon ZL, Tasca CI, Medeiros R, Calixto JB | display-authors = 6 | title = The selective and competitive N-methyl-D-aspartate receptor antagonist, (-)-6-phosphonomethyl-deca-hydroisoquinoline-3-carboxylic acid, prevents synaptic toxicity induced by amyloid-β in mice | journal = Neuroscience | volume = 192 | pages = 631–41 | date = September 2011 | pmid = 21756976 | doi = 10.1016/j.neuroscience.2011.06.038 | s2cid = 36154501 }}