LY-367,265

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-(2-(4-(6-fluoro-1H-indol-3-yl)-5,6-dihydropyridin-1(2H)-yl)ethyl)-1,4,5,6-tetrahydro-[1,2,5]thiadiazolo[4,3,2-ij]quinoline 2,2-dioxide

| image = LY-367265_structure.png

| image_class = skin-invert-image

| width = 260

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 210751-39-6

| ATC_prefix =

| ATC_suffix =

| PubChem = 4605800

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID = 3797242

| ChEBI = 183634

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = SS58UXZ8ZU

| C=24 | H=25 | F=1 | N=4 | O=2 | S=1

| smiles = FC1=CC=C2C(NC=C2C3=CCN(CCN(S4(=O)=O)C5=C6C(CCCN46)=CC=C5)CC3)=C1

| StdInChI = 1S/C24H25FN4O2S/c25-19-6-7-20-21(16-26-22(20)15-19)17-8-11-27(12-9-17)13-14-28-23-5-1-3-18-4-2-10-29(24(18)23)32(28,30)31/h1,3,5-8,15-16,26H,2,4,9-14H2

| StdInChIKey = BJIPVHLRWSDKOS-UHFFFAOYSA-N

}}

LY-367,265 is a drug developed by Eli Lilly, which acts as both a potent and selective antagonist at the serotonin 5-HT_2A receptor, and also a selective serotonin reuptake inhibitor (SSRI). It has antidepressant effects in animal studies, reduces glutamate signalling in the brain and increases the analgesic effects of morphine.{{cite journal | vauthors = Pullar IA, Carney SL, Colvin EM, Lucaites VL, Nelson DL, Wedley S | title = LY367265, an inhibitor of the 5-hydroxytryptamine transporter and 5-hydroxytryptamine(2A) receptor antagonist: a comparison with the antidepressant, nefazodone | journal = European Journal of Pharmacology | volume = 407 | issue = 1–2 | pages = 39–46 | date = October 2000 | pmid = 11050288 | doi = 10.1016/S0014-2999(00)00728-7 }}{{cite journal | vauthors = Wang SJ | title = Potential antidepressant LY 367265 presynaptically inhibits the release of glutamate in rat cerebral cortex | journal = Synapse | volume = 55 | issue = 3 | pages = 156–63 | date = March 2005 | pmid = 15602751 | doi = 10.1002/syn.20104 | s2cid = 11860623 }}{{cite journal | vauthors = Ozdemir E, Bagcivan I, Gursoy S, Altun A, Durmus N | title = Effects of fluoxetine and LY 367265 on tolerance to the analgesic effect of morphine in rats | journal = Acta Physiologica Hungarica | volume = 98 | issue = 2 | pages = 205–13 | date = June 2011 | pmid = 21616779 | doi = 10.1556/APhysiol.98.2011.2.12 }}