LY-456220

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid =

| IUPAC_name = (S)-1-(2-(4-(6-fluoro-1H-indol-3-yl)-3,6-dihydropyridin-1(2H)-yl)ethyl)isochromane-6-carboxamide

| image = LY-456220 Structure.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 439081-94-4

| ATC_prefix =

| ATC_suffix =

| PubChem = 69904149

| ChemSpiderID =

| ChEBI =

| C=25 | H=26 | F=1 | N=3 | O=2

| smiles = C1CN(CC=C1C2=CNC3=C2C=CC(=C3)F)CCC4C5=C(CCO4)C=C(C=C5)C(=O)N

| StdInChI = 1S/C25H26FN3O2/c26-19-2-4-21-22(15-28-23(21)14-19)16-5-9-29(10-6-16)11-7-24-20-3-1-18(25(27)30)13-17(20)8-12-31-24/h1-5,13-15,24,28H,6-12H2,(H2,27,30)/t24-/m0/s1

| StdInChIKey = AYGLZYIWAZBQDC-DEOSSOPVSA-N

| melting_point =

| melting_high =

}}

LY-456220 is a potent and selective serotonin 5-HT_1D receptor antagonist which has been used in research to study the function of presynaptic 5-HT_1D autoreceptors. LY-456220 lacks significant affinity for the 5-HT_1B, α₁ adrenergic, and dopamine D₂ receptors.{{cite journal | vauthors = Pullar IA, Boot JR, Broadmore RJ, Eyre TA, Cooper J, Sanger GJ, Wedley S, Mitchell SN | display-authors = 6 | title = The role of the 5-HT1D receptor as a presynaptic autoreceptor in the guinea pig | journal = European Journal of Pharmacology | volume = 493 | issue = 1-3 | pages = 85–93 | date = June 2004 | pmid = 15189767 | doi = 10.1016/j.ejphar.2004.04.029 }}{{cite journal | vauthors = Timms GH, Boot JR, Broadmore RJ, Carney SL, Cooper J, Findlay JD, Gilmore J, Mitchell S, Moore NA, Pullar I, Sanger GJ, Tomlinson R, Tree BB, Wedley S | display-authors = 6 | title = SAR development of a selective 5-HT1D antagonist/serotonin reuptake inhibitor lead using rapid parallel synthesis | journal = Bioorganic & Medicinal Chemistry Letters | volume = 14 | issue = 10 | pages = 2469–72 | date = May 2004 | pmid = 15109634 | doi = 10.1016/j.bmcl.2004.03.003 }}

It is an enantiomer of LY-456219.