LY294002
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 443344935
| ImageFile = LY294002.svg
| ImageSize =
| PIN=2-(Morpholin-4-yl)-8-phenyl-4H-1-benzopyran-4-one
| OtherNames=2-(4-Morpholinyl)-8-phenyl-4H-1-benzopyran-4-one
| Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 6004
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=154447-36-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 31M2U1DVID
| PubChem=3973
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 98350
| SMILES=C1COCCN1C2=CC(=O)C3=C(O2)C(=CC=C3)C4=CC=CC=C4
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 3835
| InChI = 1/C19H17NO3/c21-17-13-18(20-9-11-22-12-10-20)23-19-15(7-4-8-16(17)19)14-5-2-1-3-6-14/h1-8,13H,9-12H2
| InChIKey = CZQHHVNHHHRRDU-UHFFFAOYAM
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C19H17NO3/c21-17-13-18(20-9-11-22-12-10-20)23-19-15(7-4-8-16(17)19)14-5-2-1-3-6-14/h1-8,13H,9-12H2
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = CZQHHVNHHHRRDU-UHFFFAOYSA-N
}}
| Section2 = {{Chembox Properties
| C = 19 | H = 17 | N = 1 | O = 3
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
LY294002 is a morpholine-containing chemical compound that is a potent inhibitor of numerous proteins, and a strong inhibitor of phosphoinositide 3-kinases (PI3Ks).{{cite journal | vauthors = Maira SM, Stauffer F, Schnell C, García-Echeverría C | title = PI3K inhibitors for cancer treatment: where do we stand? | journal = Biochemical Society Transactions | volume = 37 | issue = Pt 1 | pages = 265–272 | date = February 2009 | pmid = 19143644 | doi = 10.1042/BST0370265 }} It is generally considered a non-selective research tool, and should not be used for experiments aiming to target PI3K uniquely.{{cite journal | vauthors = Arrowsmith CH, Audia JE, Austin C, Baell J, Bennett J, Blagg J, Bountra C, Brennan PE, Brown PJ, Bunnage ME, Buser-Doepner C, Campbell RM, Carter AJ, Cohen P, Copeland RA, Cravatt B, Dahlin JL, Dhanak D, Edwards AM, Frederiksen M, Frye SV, Gray N, Grimshaw CE, Hepworth D, Howe T, Huber KV, Jin J, Knapp S, Kotz JD, Kruger RG, Lowe D, Mader MM, Marsden B, Mueller-Fahrnow A, Müller S, O'Hagan RC, Overington JP, Owen DR, Rosenberg SH, Roth B, Ross R, Schapira M, Schreiber SL, Shoichet B, Sundström M, Superti-Furga G, Taunton J, Toledo-Sherman L, Walpole C, Walters MA, Willson TM, Workman P, Young RN, Zuercher WJ | title = The promise and peril of chemical probes | journal = Nature Chemical Biology | volume = 11 | issue = 8 | pages = 536–541 | date = August 2015 | pmid = 26196764 | pmc = 4706458 | doi = 10.1038/nchembio.1867 }}
Two of these are the proto-oncogene serine/threonine-protein kinase (PIM1) and the phosphatidylinositol-4,5-bisphosphate 3-kinase P110 gamma|catalytic subunit gamma isoform.{{cite web |url=http://www.drugbank.ca/cgi-bin/getCard.cgi?CARD=DB02656.txt |title= LY294002 |access-date=2009-09-25 |format= |work=DrugBank }} With an IC50 of 1.4 μM it is somewhat less potent than wortmannin, another well-known PI3 kinase inhibitor. However, LY294002 is a reversible inhibitor of PI3K whereas wortmannin acts irreversibly.{{cite journal | vauthors = Vlahos CJ, Matter WF, Hui KY, Brown RF | title = A specific inhibitor of phosphatidylinositol 3-kinase, 2-(4-morpholinyl)-8-phenyl-4H-1-benzopyran-4-one (LY294002) | journal = The Journal of Biological Chemistry | volume = 269 | issue = 7 | pages = 5241–5248 | date = February 1994 | pmid = 8106507 | doi = 10.1016/S0021-9258(17)37680-9 | doi-access = free }}
Application of LY294002 causes a substantial acceleration of MEPP frequency (150 μM) at the frog neuromuscular junction through a mechanism that is independent of intraterminal calcium. LY294002 causes the release of MEPPs through a perturbation of synaptotagmin function.{{cite journal | vauthors = Searl TJ, Silinsky EM | title = LY 294002 inhibits adenosine receptor activation by a mechanism independent of effects on PI-3 kinase or casein kinase II | journal = Purinergic Signalling | volume = 1 | issue = 4 | pages = 389–394 | date = December 2005 | pmid = 18404524 | pmc = 2096559 | doi = 10.1007/s11302-005-0778-6 }}
LY294002 is also a BET inhibitor (e.g. of BRD2, BRD3, and BRD4).{{cite journal | vauthors = Dittmann A, Werner T, Chung CW, Savitski MM, Fälth Savitski M, Grandi P, Hopf C, Lindon M, Neubauer G, Prinjha RK, Bantscheff M, Drewes G | title = The commonly used PI3-kinase probe LY294002 is an inhibitor of BET bromodomains | journal = ACS Chemical Biology | volume = 9 | issue = 2 | pages = 495–502 | date = February 2014 | pmid = 24533473 | doi = 10.1021/cb400789e }}
Application
=Research=
It has been shown that LY294002 administration has an additive effect on quercetin antiviral activity against hepatitis C virus.{{cite journal | vauthors = Pisonero-Vaquero S, García-Mediavilla MV, Jorquera F, Majano PL, Benet M, Jover R, González-Gallego J, Sánchez-Campos S | title = Modulation of PI3K-LXRα-dependent lipogenesis mediated by oxidative/nitrosative stress contributes to inhibition of HCV replication by quercetin | journal = Laboratory Investigation; A Journal of Technical Methods and Pathology | volume = 94 | issue = 3 | pages = 262–274 | date = March 2014 | pmid = 24492281 | doi = 10.1038/labinvest.2013.156 | doi-access = free }}