Lactide

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443418087

| ImageFile = Lactide.svg

| ImageSize = 120px

| PIN = 3,6-Dimethyl-1,4-dioxan-2,5-dione

| OtherNames = Dilactid

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 4511-42-6

| CASNo_Comment = [(S,S)-Lactide]

| CASNo2_Ref = {{cascite|changed|??}}

| CASNo2 = 25038-75-9

| CASNo2_Comment = [(R,R)-Lactide]

| CASNo3_Ref = {{cascite|changed|??}}

| CASNo3 = 13076-19-2

| CASNo3_Comment = [(R,S)-Lactide = meso-Lactide]

| CASNo4_Ref = {{cascite|correct|CAS}}

| CASNo4 = 26680-10-4

| CASNo4_Comment = [mixture of three isomers]

| CASNo5_Ref = {{cascite|correct|CAS}}

| CASNo5 = 95-96-5

| CASNo5_Comment = [mixture of three isomers][http://www.sigmaaldrich.com/catalog/product/aldrich/303143?lang=en®ion=GB Sigma Aldrich product page for lactide] Retrieved 8th of July 2015

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = IJ13TO4NO1

| UNII_Comment = [(S,S)-Lactide]

| UNII4_Ref = {{fdacite|correct|FDA}}

| UNII4 = 9J7G894K2M

| UNII4_Comment = [mixture of three isomers]

| UNII5_Ref = {{fdacite|correct|FDA}}

| UNII5 = 7EH08MWO6M

| UNII5_Comment = [mixture of three isomers]

| PubChem = 7272

| ChemSpiderID = 7002

| EC_number = 202-468-3

| StdInChI=1S/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3

| StdInChIKey = JJTUDXZGHPGLLC-UHFFFAOYSA-N

| SMILES = CC1C(=O)OC(C(=O)O1)C

}}

|Section2={{Chembox Properties

| C = 6

| H = 8

| O = 4

| MeltingPtC = 95 to 97

| MeltingPt_notes = [(S,S)-Lactide and (R,R)-Lactide][http://www.roempp.com/prod/index1.html Römpp Online Chemielexikon Version 3.3] aufgerufen am 25. März 2009

| Solubility = Hydrolyses to lactic acid

| SolubleOther = soluble in chloroform, methanol
slightly soluble in benzene

}}

|Section7={{Chembox Hazards

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|319}}

| PPhrases = {{P-phrases|264|280|305+351+338|337+313}}

}}

}}

Lactide is the lactone cyclic ester derived by multiple esterification between two (usually) or more molecules from lactic acid (2-hydroxypropionic acid) or other hydroxy carboxylic acid. They are designated as dilactides, trilactides, etc., according to the number of hydroxy acid residues. All lactides are colorless or white solids. The dilactide derived from lactic acid has the formula {{chem2|[CH(CH3)CO2]2}}. This lactide has attracted interest because it is derived from abundant renewable resources and is the precursor to a biodegradable plastic.{{cite encyclopedia|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|chapter=Polymers, Biodegradable|author=Andreas Künkel |author2=Johannes Becker |author3=Lars Börger |author4=Jens Hamprecht |author5=Sebastian Koltzenburg |author6=Robert Loos |author7=Michael Bernhard Schick |author8=Katharina Schlegel |author9=Carsten Sinkel |author10=Gabriel Skupin |author11=Motonori Yamamoto |pages=1–29|year=2016|publisher=Wiley-VCH|place=Weinheim|doi=10.1002/14356007.n21_n01.pub2|isbn=978-3-527-30673-2|doi-access=free}}