Lanostane

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424957756

| ImageFile = Lanostane.svg

| ImageAlt =

| ImageSize = 250

| IUPACName =

| OtherNames = 4,4,14α-Trimethylcholestane

|Section1={{Chembox Identifiers

| CASNo = 474-20-4

| CASNo_Comment = (5α)

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo1 = 57496-02-3

| CASNo1_Comment = (5β)

| CASNo1_Ref = {{cascite|correct|CAS}}

| PubChem1 = 9548665

| PubChem1_Comment = (5α)

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 7827588

| ChemSpiderID_Comment = (5α)

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 20265

| ChEBI_Comment = (5α)

| SMILES1 = C[C@H](CCCC(C)C)[C@@]1([H])CC[C@@]2(C)[C@]3([H])CC[C@@]4([H])C(C)(C)CCC[C@]4(C)[C@@]3([H])CC[C@@]21C

| SMILES1_Comment = (5α)

| SMILES2 = C[C@H](CCCC(C)C)[C@@]1([H])CC[C@@]2(C)[C@]3([H])CC[C@]4([H])C(C)(C)CCC[C@]4(C)[C@@]3([H])CC[C@@]21C

| SMILES2_Comment = (5β)

| InChI = 1/C30H54/c1-21(2)11-9-12-22(3)23-15-19-30(8)25-13-14-26-27(4,5)17-10-18-28(26,6)24(25)16-20-29(23,30)7/h21-26H,9-20H2,1-8H3/t22-,23-,24+,25-,26+,28-,29-,30+/m1/s1

| InChI_Comment = (5α)

| InChIKey = ZQIOPEXWVBIZAV-ZKYCIREVBA

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C30H54/c1-21(2)11-9-12-22(3)23-15-19-30(8)25-13-14-26-27(4,5)17-10-18-28(26,6)24(25)16-20-29(23,30)7/h21-26H,9-20H2,1-8H3/t22-,23-,24+,25-,26+,28-,29-,30+/m1/s1

| StdInChI_Comment = (5α)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZQIOPEXWVBIZAV-ZKYCIREVSA-N

}}

|Section2={{Chembox Properties

| C=30 | H=54

| Appearance =

| Density =

| MeltingPtC = 98 to 99

| MeltingPt_ref = {{cite journal | doi = 10.1002/hlca.19500330658 | author = Voser, W. | last2 = Montavon | first2 = M. | last3 = Günthard | first3 = Hs. H. | last4 = Jeger | first4 = O. | last5 = Ruzicka | first5 = L. | title = Zur Kenntnis der Triterpene. 156. Mitteilung. Zur Konstitution des Lanostadienols | journal = Helvetica Chimica Acta | year = 1950 | volume = 33 | issue = 6 | pages = 1893–1910}}

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Lanostane or 4,4,14α-trimethylcholestane is a tetracyclic chemical compound with formula {{chem|C|30|H|54}}. It is a polycyclic hydrocarbon, specifically a triterpene. It is an isomer of cucurbitane.

The name is applied to two stereoisomers, distinguished by the prefixes 5α- and 5β-, which differ by the handedness of the bonds at a particular carbon atom (number 5 in the standard steroid numbering scheme).

File:5alpha-lanostane.svg|5α-Lanostane

File:5beta-lanostane.svg|5β-Lanostane

Replacement of a hydrogen atom attached to carbon number 3 in the 5α isomer with a hydroxyl group results in lanosterol, the biogenetic precursor of the steroids in animals.{{cite journal |author=IUPAC Commission on the Nomenclature of Organic Chemistry and IUPAC-IUB Commission on Biochemical Nomenclature |year=1969 |title=The Nomenclature of Steroids — Revised Tentative Rules |journal=European Journal of Biochemistry |volume=10 |issue=1 |pages=1–19 |doi=10.1111/j.1432-1033.1969.tb00650.x |doi-access=free }}