Lead picrate

{{Chembox

| ImageFile = Lead picrate.svg

| ImageSize = 180px

| ImageAlt =

| IUPACName = Lead(II) 2,4,6-trinitrophenolate

| OtherNames = Lead dipicrate

| Section1 = {{Chembox Identifiers

| CASNo = 25721-38-4

| CASNo1 = 6477-64-1

ChemSpider ID: 2308056

| PubChem = 3045289

| PubChem1 = 162344796

| SMILES = C1=C(C=C(C(=C1[N+](=O)[O-])[O-])[N+](=O)[O-])[N+](=O)[O-].C1=C(C=C(C(=C1[N+](=O)[O-])[O-])[N+](=O)[O-])[N+](=O)[O-].[Pb+2]

| InChI=1S/2C6H3N3O7.Pb/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h2*1-2,10H;/q;;+2/p-2

| InChIKey=MHVVRZIRWITSIP-UHFFFAOYSA-L

| EINECS =229-335-2

}}

| Section2 = {{Chembox Properties

| C=12|H=4|N=6|O=14|Pb=1

| Appearance = Orange powder

| Solubility = 7.06 g/L {{Cite journal |last1=Yang |first1=Li |last2=Pei |first2=Qin |last3=Zhang |first3=Tonglai |last4=Zhang |first4=Jianguo |last5=Cao |first5=Yunling |date=2007 |title=Solubilities and enthalpies of solution of picric acid and picrates at 298.15K in DMF, EtOH and acetic acid |url=https://linkinghub.elsevier.com/retrieve/pii/S0040603107001621 |journal=Thermochimica Acta |language=en |volume=463 |issue=1–2 |pages=13–14 |doi=10.1016/j.tca.2007.04.013|bibcode=2007TcAc..463...13Y }}

| SolubleOther = Soluble in ethanol, acetic acid
Very soluble in DMF, dichloromethane{{Cite journal |last1=Matsukakwa |first1=Makoto |last2=Matsunaga |first2=Takehiro |last3=Yoshida |first3=Masatake |last4=Fujiwara |first4=Shuzo |date=2004 |title=Synthesis and properties of lead picrates |journal=Science and Technology of Energetic Materials |volume=65 |issue=1 |pages=7–13}}

}}

| Section3 =

| Section5 = {{Chembox Explosive

}}

| Section7 = {{Chembox Hazards

| GHSPictograms = {{GHS01}} {{GHS07}} {{GHS health hazard}} {{GHS environment}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|201|302|332|360|373|410}}

| PPhrases = {{P-phrases|260|261|264|270|271|273|280|304+340|330|391|405|501}}

| AutoignitionPt = 270.75-327.15 °C (519.7-621.0 °F; 600.3-543.9 K)

}}

}}

Lead picrate is an organic picrate salt.{{cite book | title = High Energy Materials: Propellants, Explosives and Pyrotechnics | author = Jai Prakash Agrawal | publisher = John Wiley & Sons | date = 2015}} It is a sensitive and highly explosive compound that is typically found as a hydrate. Dry lead picrate is incredibly dangerous and cannot be handled without explosive decomposition occurring.