Leflutrozole

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 4-[(4-Cyanophenyl)-fluoro-(1,2,4-triazol-1-yl)methyl]benzonitrile

| image = Leflutrozole.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 143030-47-1

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 126735

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 112569

| UNII = RCX0IE6EJZ

| KEGG =

| ChEBI =

| ChEMBL = 225550

| synonyms = BGS-649; CGP-47645

| C=17 | H=10 | F=1 | N=5

| SMILES = C1=CC(=CC=C1C#N)C(C2=CC=C(C=C2)C#N)(N3C=NC=N3)F

| StdInChI_Ref =

| StdInChI = 1S/C17H10FN5/c18-17(23-12-21-11-22-23,15-5-1-13(9-19)2-6-15)16-7-3-14(10-20)4-8-16/h1-8,11-12H

| StdInChIKey_Ref =

| StdInChIKey = PZDLRBUQYWMNBR-UHFFFAOYSA-N

}}

Leflutrozole (developmental code names BGS-649, CGP-47645) is an aromatase inhibitor which is under development by Mereo BioPharma and Novartis for the treatment of hypogonadism in men.{{Cite web|url=http://adisinsight.springer.com/drugs/800032111|title = Leflutrozole - Mereo BioPharma - AdisInsight}} It was also under investigation for the treatment of endometriosis, but development for this indication was discontinued. As of December 2017, leflutrozole is in phase II clinical trials for hypogonadism.