Legonmycin
{{Short description|Group of chemical compounds}}
{{Chembox
| ImageFile = Legonmycin A.svg
| ImageSize = 180px
| ImageFile2 = Legonmycin B.svg
| ImageSize2 = 200px
| ImageCaption2 = Legonmycin A (top) and legonmycin B
| IUPACName = A: N-(8-Hydroxy-2-methyl-1-oxo-6,7-dihydro-5H-pyrrolizin-3-yl)-3-methylbutanamide
B: N-(8-Hydroxy-2-methyl-1-oxo-6,7-dihydro-5H-pyrrolizin-3-yl)-4-methylpentanamide
| OtherNames =
| Section1 = {{Chembox Identifiers
| index1_label = A
| index2_label = B
| CASNo1 = 1802522-27-5
| CASNo2 = 1802522-28-6
| ChemSpiderID1 = 40257825
| PubChem1 = 139585189
| PubChem2 = 156583135
| InChI1=1S/C13H20N2O3/c1-8(2)7-10(16)14-12-9(3)11(17)13(18)5-4-6-15(12)13/h8,18H,4-7H2,1-3H3,(H,14,16)
| InChIKey1 = PLSCDSCQUZWYJL-UHFFFAOYSA-N
| InChI2=1S/C14H22N2O3/c1-9(2)5-6-11(17)15-13-10(3)12(18)14(19)7-4-8-16(13)14/h9,19H,4-8H2,1-3H3,(H,15,17)
| InChIKey2 = STVITZBETCSTPL-UHFFFAOYSA-N
| SMILES1 = CC1=C(N2CCCC2(C1=O)O)NC(=O)CC(C)C
| SMILES2 = CC1=C(N2CCCC2(C1=O)O)NC(=O)CCC(C)C
}}
| Section2 = {{Chembox Properties
| Formula = A: C13H20N2O3
B: C14H22N2O3
| MolarMass =
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Legonmycins are a group of chemical compounds that belong to the pyrrolizidine family of naturally occurring alkaloids. Discovered by a joint team of researchers from University of Ghana, University of Aberdeen, and Wuhan University, the compounds were isolated from Streptomyces microorganisms in Legon, a suburb of Accra, Ghana.{{cite journal | doi = 10.1002/anie.201502902 | title = Discovery of a Single Monooxygenase that Catalyzes Carbamate Formation and Ring Contraction in the Biosynthesis of the Legonmycins | date = 2015 | last1 = Huang | first1 = Sheng | last2 = Tabudravu | first2 = Jioji | last3 = Elsayed | first3 = Somayah S. | last4 = Travert | first4 = Jeanne | last5 = Peace | first5 = Doe | last6 = Tong | first6 = Ming Him | last7 = Kyeremeh | first7 = Kwaku | last8 = Kelly | first8 = Sharon M. | last9 = Trembleau | first9 = Laurent | last10 = Ebel | first10 = Rainer | last11 = Jaspars | first11 = Marcel | last12 = Yu | first12 = Yi | last13 = Deng | first13 = Hai | journal = Angewandte Chemie International Edition | volume = 54 | issue = 43 | pages = 12697–12701 | pmid = 26206556 }}{{cite news | url=http://citifmonline.com/2015/08/06/new-cancer-fighting-agent-named-after-legon/ | title=New cancer fighting agent named after Legon | work=Citifmonline | date=August 6, 2015 | accessdate=August 7, 2015 | author=Pius Amihere Eduku}}{{cite news | url=http://pulse.com.gh/campus/legonmycins-new-cancer-fighting-agent-named-after-university-of-ghana-id4043593.html | title=New cancer fighting agent named after University of Ghana | work=Pulse.com | date=August 8, 2015 | accessdate=August 7, 2015 | author=Betty Kankam-Boadu}}{{cite news | url=http://www.ghananewsagency.org/science/university-of-ghana-discovers-cancer-fighting-agents-92741 | title=University of Ghana discovers Cancer fighting agents | work=Ghana News Agency | date=August 5, 2015 | accessdate=August 7, 2015}} Laboratory syntheses of legonmycin A and legonmycin B have been reported.{{cite journal | pmc = 7871033 | pmid = 33828615 | date = 2021 | author1 = Lewis WJM | last2 = Shaw | first2 = D. M. | last3 = Robertson | first3 = J. | title = Synthesis of legonmycins a and B, C(7a)-hydroxylated bacterial pyrrolizidines | journal = Beilstein Journal of Organic Chemistry | volume = 17 | pages = 334–342 | doi = 10.3762/bjoc.17.31 }}