Licarbazepine

{{Short description|Active metabolite of oxcarbazepine}}

{{Drugbox

| IUPAC_name = (RS)-10,11-Dihydro-10-hydroxy-5H-dibenz[b,f]azepine-5-carboxamide

| image = Licarbazepine.svg

| width = 170

| caption = Top: (R)-(−)-licarbazepine
Bottom: (S)-(+)-licarbazepine

| drug_name =

| chirality = Racemic mixture

| tradename =

| licence_EU =

| licence_US =

| DailyMedID =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| dependency_liability =

| routes_of_administration =

| bioavailability =

| protein_bound = <40%

| metabolism =

| metabolites = Glucuronides

| elimination_half-life =

| excretion = Mainly renal

| CAS_number = 29331-92-8

| CAS_supplemental =

| ATCvet =

| ATC_prefix = None

| ATC_suffix =

| ATC_supplemental =

| PubChem = 114709

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = XFX1A5KJ3V

| ChEMBL = 1067

| ChemSpiderID = 102704

| KEGG = D09215

| chemical_formula =

| C=15 | H=14 | N=2 | O=2

| smiles = NC(=O)N1c2ccccc2CC(O)c3ccccc13

| StdInChI = 1S/C15H14N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8,14,18H,9H2,(H2,16,19)

| StdInChIKey = BMPDWHIDQYTSHX-UHFFFAOYSA-N

| synonyms =

| density =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| specific_rotation =

| sec_combustion =

}}

Licarbazepine is a voltage-gated sodium channel blocker with anticonvulsant and mood-stabilizing effects that is related to oxcarbazepine.{{cite journal | vauthors = Singh RP, Asconapé JJ | title = A review of eslicarbazepine acetate for the adjunctive treatment of partial-onset epilepsy | journal = Journal of Central Nervous System Disease | volume = 3 | pages = 179–87 | year = 2011 | pmid = 23861647 | pmc = 3663619 | doi = 10.4137/JCNSD.S4888 }} It is an active metabolite of oxcarbazepine.{{cite journal | vauthors = Bialer M, Soares-da-Silva P | title = Pharmacokinetics and drug interactions of eslicarbazepine acetate | journal = Epilepsia | volume = 53 | issue = 6 | pages = 935–46 | date = June 2012 | pmid = 22612290 | doi = 10.1111/j.1528-1167.2012.03519.x | s2cid = 21233948 | doi-access = free }} In addition, an enantiomer of licarbazepine, eslicarbazepine ((S)-(+)-licarbazepine), is an active metabolite of eslicarbazepine acetate. Oxcarbazepine and eslicarbazepine acetate are inactive on their own, and behave instead as prodrugs to licarbazepine and eslicarbazepine, respectively, to produce their therapeutic effects.

References

{{Reflist|2}}

{{Anticonvulsants}}

{{Mood stabilizers}}

{{Neuropathic pain and fibromyalgia pharmacotherapies}}

{{Channel blockers}}

{{Tricyclics}}

Category:Secondary alcohols

Category:Anticonvulsants

Category:Dibenzazepines

Category:Human drug metabolites

Category:Mood stabilizers

Category:Ureas

{{anticonvulsant-stub}}