Limonin

{{chembox

| Verifiedfields = changed

| verifiedrevid = 477498078

| ImageFile = Limonin.svg

| ImageSize =

| ImageFile1 = Limonin molecule ball.png

| ImageSize1 = 220

| ImageAlt1 = Ball-and-stick model of limonin

| PIN = (2aR,4aR,4bR,5aS,8S,8aS,10aR,10bR,14aS)-8-(Furan-3-yl)-2,2,4a,8a-tetramethyldecahydro-11H,13H-oxireno[2,3-c]pyrano[4′′,3′′:2′,3′]furo[3′,4′:5,6]naphtho[1,2-d]pyran-4,6,13(2H,5aH)-trione

| OtherNames = {{ubl|Limonoate D-ring-lactone|Limonoic acid di-δ-lactone|7,16-Dioxo-7,16-dideoxylimondiol}}

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 1180-71-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L0F260866S

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 16226

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 517449

| PubChem = 179651

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 156367

| SMILES = O=C4[C@@]6(C)[C@@]72O[C@@H]7C(=O)O[C@@H](c1ccoc1)[C@]2(C)CC[C@@H]6[C@]35COC(=O)C[C@@H]5OC([C@@H]3C4)(C)C

| InChI = 1/C26H30O8/c1-22(2)15-9-16(27)24(4)14(25(15)12-31-18(28)10-17(25)33-22)5-7-23(3)19(13-6-8-30-11-13)32-21(29)20-26(23,24)34-20/h6,8,11,14-15,17,19-20H,5,7,9-10,12H2,1-4H3/t14-,15-,17-,19-,20+,23-,24-,25+,26+/m0/s1

| InChIKey = KBDSLGBFQAGHBE-MSGMIQHVBF

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C26H30O8/c1-22(2)15-9-16(27)24(4)14(25(15)12-31-18(28)10-17(25)33-22)5-7-23(3)19(13-6-8-30-11-13)32-21(29)20-26(23,24)34-20/h6,8,11,14-15,17,19-20H,5,7,9-10,12H2,1-4H3/t14-,15-,17-,19-,20+,23-,24-,25+,26+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KBDSLGBFQAGHBE-MSGMIQHVSA-N

}}

|Section2={{Chembox Properties

| Formula = C₂₆H₃₀O₈

| MolarMass = 470.52 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

{{distinguish|Limonene}}

Limonin is a limonoid, and a bitter, white, crystalline substance found in citrus and other plants. It is also known as limonoate D-ring-lactone and limonoic acid di-delta-lactone. Chemically, it is a member of the class of compounds known as furanolactones.