Lithium triflate
{{Chembox
| ImageFile = Lithium triflate.svg
| ImageSize = 150px
| PIN = Lithium trifluoromethanesulfonate
| OtherNames = LiOTf
| Section1 = {{Chembox Identifiers
| CASNo = 33454-82-9
| PubChem = 3664839
| UNII = 1C966KV50I
| ChemSpiderID = 105900
| EC_number = 251-528-5
| SMILES = [Li+].C(F)(F)(F)S(=O)(=O)[O-]
| StdInChI=1S/CHF3O3S.Li/c2-1(3,4)8(5,6)7;/h(H,5,6,7);/q;+1/p-1
| StdInChIKey = MCVFFRWZNYZUIJ-UHFFFAOYSA-M
}}
| Section2 = {{Chembox Properties
| C=1 | F=3 | Li=1 | O=3 | S=1
| Appearance = White solid
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Lithium triflate (lithium triflouromethanesulfonate or LiOTf) is a salt with the chemical formula LiCF3SO3. It is composed of the lithium cation (Li+) and triflate anion (CF3SO3−; TfO−). It is very hygroscopic. The salt is used in lithium-ion battery production.[https://www.sigmaaldrich.com/catalog/product/aldrich/481548?lang=en®ion=SE Lithium trifluoromethanesulfonate, Sigma Aldrich]
:File:LithiumTriflateHygroscopy.jpg{{clear-left}}
