Litracen

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-(10,10-dimethylanthracen-9(10H)-ylidene)-N-methylpropan-1-amine

| image = Litracen.png

| image_class = skin-invert-image

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 5118-30-9

| CAS_supplemental =
10563-71-0

| ATC_prefix = none

| ATC_suffix =

| PubChem = 82730

| ChemSpiderID = 74659

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2B3D399IVR

| C=20 | H=23 | N=1

| smiles = c3ccc2c(/C(c1c(cccc1)C2(C)C)=C\CCNC)c3

}}

Litracen (N-7,049) is a tricyclic antidepressant which was never marketed.{{cite book | author = David J. Triggle | title = Dictionary of Pharmacological Agents | publisher = Chapman & Hall/CRC | location = Boca Raton | year = 1996 | isbn = 0-412-46630-9 | url = https://books.google.com/books?id=A0THacd46ZsC&q=litracen&pg=PA1225}}{{cite journal |vauthors=Nielsen IM, Nymark M, Hougs W, Pedersen V | title = The pharmacological properties of melitracen (N 7001) and litracen (N 7049) | journal = Arzneimittel-Forschung | volume = 16 | issue = 2 | pages = 135–40 |date=February 1966 | pmid = 6014004 }}