Lorediplon

{{short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 459125087

| IUPAC_name = N-{2-fluoro-5-[3-(thiophen-2-ylcarbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl}-N-methylacetamide

| image = Lorediplon.svg

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 917393-39-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = VKU6Z23NSY

| ATC_prefix = None

| ATC_suffix =

| PubChem = 12004146

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10176613

| ChEMBL = 4303403

| C = 20 | H = 15 | F = 1 | N = 4 | O = 2 | S = 1

| smiles = O=C(c2cnn3c(c1ccc(F)c(N(C(=O)C)C)c1)ccnc23)c4sccc4

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H15FN4O2S/c1-12(26)24(2)17-10-13(5-6-15(17)21)16-7-8-22-20-14(11-23-25(16)20)19(27)18-4-3-9-28-18/h3-11H,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NQPOCLFSADOXBR-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status = Non-regulated

| routes_of_administration =

}}

Lorediplon (INN) is a nonbenzodiazepine of the pyrazolopyrimidine family that is being pursued as a treatment for insomnia but has not completed development.{{cite journal | author = World Health Organization | title = International Nonproprietary Names for Pharmaceutical Substances (INN): Proposed INN: List 105 | journal = WHO Drug Information | volume = 25 | issue = 2 | page = 179 | year = 2011 | url =https://www.who.int/medicines/publications/druginformation/innlists/finalPL105.pdf}}{{cite book | veditors = Uddin MS, Rashid M |title=Advances in Neuropharmacology: Drugs and Therapeutics |date=2020 |publisher=Apple Academic Press |location=New York |isbn=978-0-429-51589-7 | chapter = Sedative and Hypnotic Drugs | vauthors = Misra AK, Sharma PK | chapter-url= https://books.google.com/books?id=L3jNDwAAQBAJ&dq=Lorediplon&pg=PT441 | page = 441 }}