Lucifer yellow

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 410367079

| ImageFile = Lucifer yellow.svg

| ImageSize = 200px

| PIN = Dilithium 6-amino-2-(hydrazinecarbonyl)-1,3-dioxo-2,3-dihydro-1H-benzo[de]isoquinoline-5,8-disulfonate

|Section1={{Chembox Identifiers

| CASNo = 77944-88-8

| CASNo_Ref = {{Cascite|changed|CAS}}

| PubChem = 20835957

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 52104

| ChEMBL = 1650069

| UNII = 9654F8OVKE

| SMILES = c1c(cc2c3c1c(c(cc3c(=O)n(c2=O)C(=O)NN)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Li+].[Li+]

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 20137740

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H10N4O9S2.2Li/c14-10-5-1-4(27(21,22)23)2-6-9(5)7(3-8(10)28(24,25)26)12(19)17(11(6)18)13(20)16-15;;/h1-3H,14-15H2,(H,16,20)(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = DLBFLQKQABVKGT-UHFFFAOYSA-L

}}

|Section2={{Chembox Properties

| C=13 | H=10 | Li=2 | N=4 | O=9 | S=2

}}

}}

Lucifer yellow is a fluorescent dye used in cell biology.{{cite journal|last=Hanani|first=Menachem|title=Lucifer yellow – an angel rather than the devil|journal=Journal of Cellular and Molecular Medicine|date=January 2012|volume=16|issue=2|pages=22–31|doi=10.1111/j.1582-4934.2011.01378.x|pmid=21740513|pmc=3823090}} The key property of Lucifer yellow is that it can be readily visualized in both living and fixed cells using a fluorescence microscope. Lucifer yellow was invented by Walter W. Stewart at the National Institutes of Health and patented in 1978.[http://www.freepatentsonline.com/4473693.html Patent description]