Lucitanib

{{Short description|Chemical compound}}

{{Infobox drug

| IUPAC_name = 6-({7-[(1-Aminocyclopropyl)methoxy]-6-methoxy-4-quinolinyl}oxy)-N-methyl-1-naphthamide

| image = Lucitanib.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_category=

| routes_of_administration = By mouth

| legal_AU =

| legal_AU_comment =

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_UN =

| legal_status = Investigational

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life = 31–40 hrs

| duration_of_action =

| excretion =

| CAS_number = 1058137-23-7

| class =

| ATCvet =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 25031915

| DrugBank =

| ChemSpiderID = 28189586

| UNII = PP449XA4BH

| KEGG = D11762

| ChEBI = 65209

| ChEMBL = 2180605

| synonyms = CO-3810, E-3810

| chemical_formula =

| C=26 | H=25| N=3 | O=4

| smiles = CNC(=O)c1cccc2c1ccc(c2)Oc3ccnc4c3cc(c(c4)OCC5(CC5)N)OC

| StdInChI=1S/C26H25N3O4/c1-28-25(30)19-5-3-4-16-12-17(6-7-18(16)19)33-22-8-11-29-21-14-24(23(31-2)13-20(21)22)32-15-26(27)9-10-26/h3-8,11-14H,9-10,15,27H2,1-2H3,(H,28,30)

| StdInChIKey = CUDVHEFYRIWYQD-UHFFFAOYSA-N

}}

Lucitanib (INN) is a drug that is being investigated by Clovis Oncology in clinical trials for the treatment of advanced solid tumours{{cite journal | vauthors = Soria JC, DeBraud F, Bahleda R, Adamo B, Andre F, Dienstmann R, Dientsmann R, Delmonte A, Cereda R, Isaacson J, Litten J, Allen A, Dubois F, Saba C, Robert R, D'Incalci M, Zucchetti M, Camboni MG, Tabernero J | display-authors = 6 | title = Phase I/IIa study evaluating the safety, efficacy, pharmacokinetics, and pharmacodynamics of lucitanib in advanced solid tumors | journal = Annals of Oncology | volume = 25 | issue = 11 | pages = 2244–51 | date = November 2014 | pmid = 25193991 | doi = 10.1093/annonc/mdu390 | doi-access = free }} including metastatic breast cancer.{{ClinicalTrialsGov|NCT02053636|A Phase II Trial Testing Oral Administration of Lucitanib in Patients With Fibroblast Growth Factor Receptor (FGFR)1-amplified or Non-amplified Estrogen Receptor Positive Metastatic Breast Cancer (FINESSE)}} It is a protein kinase inhibitor that blocks the VEGF receptors 1, 2 and 3, as well as the fibroblast growth factor receptors 1 and 2, and the platelet-derived growth factor receptors alpha and beta.