Luliconazole

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| IUPAC_name = (2E)-[(4R)-4-(2,4-Dichlorophenyl)-1,3-dithiolan-2-ylidene](1H-imidazol-1-yl)acetonitrile

| image = Luliconazole.svg

| image2 = Luliconazole ball-and-stick model.png

| alt =

| caption =

| tradename = Luzu, Luzarn, Lulicon, LULY, Zyluli,Luris

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Topical

| bioavailability =

| protein_bound = >99%{{cite web|title=LUZU (luliconazole) Cream, 1%. Full Prescribing Information.|url=http://www.valeant.com/Portals/25/Pdf/PI/Luzurx-PI.pdf|publisher=Valeant Pharmaceuticals North America LLC|accessdate=1 October 2015}}

| metabolism =

| elimination_half-life =

| excretion =

| ATCvet =

| ATC_prefix = D01

| ATC_suffix = AC18

| ATC_supplemental =

| DrugBank = DB08933

| CAS_number = 187164-19-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RE91AN4S8G

| PubChem = 3003141

| ChemSpiderID = 2273807

| smiles = C1[C@H](S/C(=C(\C#N)/N2C=CN=C2)/S1)C3=C(C=C(C=C3)Cl)Cl

| StdInChI = 1S/C14H9Cl2N3S2/c15-9-1-2-10(11(16)5-9)13-7-20-14(21-13)12(6-17)19-4-3-18-8-19/h1-5,8,13H,7H2/b14-12+/t13-/m0/s1

| StdInChIKey = YTAOBBFIOAEMLL-REQDGWNSSA-N

| C=14 | H=9 | Cl=2 | N=3 | S=2

}}

Luliconazole, trade names Luzu among others, is an imidazole antifungal medication.{{cite journal | vauthors = Gupta AK, Daigle D | title = A critical appraisal of once-daily topical luliconazole for the treatment of superficial fungal infections | journal = Infection and Drug Resistance | volume = 9 | issue = | pages = 1–6 | date = 2016 | pmid = 26848272 | pmc = 4723097 | doi = 10.2147/IDR.S61998 | doi-access = free }} As a 1% topical cream, It is indicated for the treatment of athlete's foot, jock itch, and ringworm caused by dermatophytes such as Trichophyton rubrum, Microsporum gypseum,{{cite news|url=http://formularyjournal.modernmedicine.com/formulary-journal/news/fda-approves-luliconazole-tinea-pedis|title=FDA approves luliconazole for tinea pedis|date=November 19, 2013|accessdate=14 January 2014|archive-url=https://web.archive.org/web/20140116083218/http://formularyjournal.modernmedicine.com/formulary-journal/news/fda-approves-luliconazole-tinea-pedis|archive-date=16 January 2014|url-status=dead}} and ''Epidermophyton floccosum.