Luteone (isoflavone)

{{other uses|Luteone (disambiguation)}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424930453

| Name = Luteone

| ImageFile = Luteone.svg

| ImageName = Chemical structure of luteone

| IUPACName = 2′,4′,5,7-Tetrahydroxy-6-(3-methylbut-2-en-1-yl)isoflavone

| SystematicName = 3-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-6-(3-methylbut-2-en-1-yl)-4H-1-benzopyran-4-one

| OtherNames = Ruizgenin

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 41743-56-0

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = FU3E0232IF

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4445109

| PubChem = 5281797

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 27917

| ChEMBL = 549617

| KEGG = C10498

| 3DMet = B03983

| SMILES = CC(=CCC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=C(C=C(C=C3)O)O)O)C

| InChI = 1S/C20H18O6/c1-10(2)3-5-13-16(23)8-17-18(19(13)24)20(25)14(9-26-17)12-6-4-11(21)7-15(12)22/h3-4,6-9,21-24H,5H2,1-2H3

| InChIKey = MMPVAPMCVABQPS-UHFFFAOYSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=20 | H=18 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

}}

Luteone is a prenylated isoflavone, a type of flavonoid. It can be found in the pods of Laburnum anagyroides{{cite journal | url = http://cat.inist.fr/?aModele=afficheN&cpsidt=3619889 | title = Isoflavones from pods of Laburnum anagyroides |author1=Sato H. |author2=Tahara S. |author3=Ingham J. L. |author4=Dziedzic S. Z. |journal = Phytochemistry | year = 1995 | volume = 39 | issue = 3 | pages = 673–676 | doi = 10.1016/0031-9422(95)00029-7}} and can be synthesized.{{cite journal | url = http://sciencelinks.jp/j-east/article/200110/000020011001A0106511.php | title = Regioselective Synthesis of Prenylisoflavones. Syntheses of Luteone and Luteone Hydrate |author1=Tsukayama M. |author2=Wada H. |author3=Kishida M. |author4=Nishiuchi M. |author5=Kawamura Y. | journal = Chem Lett | issue = 12 | pages = 1362–1363 | year = 2000 | volume = 29 | doi = 10.1246/cl.2000.1362}}