Lysergic acid methyl ester
{{Chembox
| verifiedrevid = 421064697
| ImageFile = Lysergic acid methyl ester.svg
| ImageSize = 150px
| IUPACName = Methyl 6-methyl-9,10-didehydroergoline-8β-carboxylate
| SystematicName = Methyl (6aR,9R)-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid
| OtherNames = Methyl lysergate
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 9589747
| InChI = 1/C17H18N2O2/c1-19-9-11(17(20)21-2)6-13-12-4-3-5-14-16(12)10(8-18-14)7-15(13)19/h3-6,8,11,15,18H,7,9H2,1-2H3/t11-,15-/m1/s1
| InChIKey = RNHDWLRHUJZABX-IAQYHMDHBA
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H18N2O2/c1-19-9-11(17(20)21-2)6-13-12-4-3-5-14-16(12)10(8-18-14)7-15(13)19/h3-6,8,11,15,18H,7,9H2,1-2H3/t11-,15-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RNHDWLRHUJZABX-IAQYHMDHSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 4579-64-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 13782F2619
| PubChem = 11414860
| SMILES = O=C(OC)[C@@H]3/C=C2/c4cccc1c4c(c[nH]1)C[C@H]2N(C3)C
}}
|Section2={{Chembox Properties
| C=17 | H=18 | N=2 | O=2
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Lysergic acid methyl ester is an analogue of lysergic acid.{{Citation |last=Hwang |first=Kristine Anne J. |title=Lysergic Acid Diethylamide (LSD) |date=2022 |url=http://www.ncbi.nlm.nih.gov/books/NBK482407/ |work=StatPearls |archive-url=https://web.archive.org/web/20221119181430/https://www.ncbi.nlm.nih.gov/books/NBK482407/ |place=Treasure Island (FL) |publisher=StatPearls Publishing |pmid=29494014 |access-date=2022-11-19 |archive-date=2022-11-19 |last2=Saadabadi |first2=Abdolreza}} It it has been reported to act on serotonin receptors.{{Cite journal |last=Libânio Osório Marta |first=Rui Filipe |date=2019-08-09 |title=Metabolism of lysergic acid diethylamide (LSD): an update |url=https://pubmed.ncbi.nlm.nih.gov/31266388/ |url-status=live |journal=Drug Metabolism Reviews |volume=51 |issue=3 |pages=378–387 |doi=10.1080/03602532.2019.1638931 |issn=1097-9883 |pmid=31266388 |archive-url=https://web.archive.org/web/20221119181244/https://pubmed.ncbi.nlm.nih.gov/31266388/ |archive-date=2022-11-19 |access-date=2022-11-19 |via=National Library of Medicine}}
References
{{Reflist}}
External links
- [http://www.erowid.org/archive/rhodium/chemistry/lysergic.amides.html Preparation of lysergic acid esters]
- [http://www.freepatentsonline.com/4524208.html Process for the preparation of lysergic acid esters - Patent 4524208]
{{Serotonin receptor modulators}}
{{Ergolines}}