M62812

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 6-(2-aminophenoxy)-1,2-benzothiazol-3-amine

| image = M62812_structure.png

| image_class = skin-invert-image

| tradename =

| legal_US =

| legal_status =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 613262-61-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D98NBX7QJ5

| PubChem = 44224215

| ChemSpiderID = 24691458

| ChEMBL = 458612

| C=13 | H=11 | N=3 | O=1 | S=1

| SMILES = C1=CC=C(C(=C1)N)OC2=CC3=C(C=C2)C(=NS3)N

| StdInChI=1S/C13H11N3OS/c14-10-3-1-2-4-11(10)17-8-5-6-9-12(7-8)18-16-13(9)15/h1-7H,14H2,(H2,15,16)

| StdInChIKey = HQCTTYOADNAJJR-UHFFFAOYSA-N

}}

M62812 is a drug which acts as a potent and selective antagonist of toll-like receptor 4 (TLR4). In animal studies it blocks TLR4-mediated cytokine release and has antiinflammatory effects, showing efficacy in animal models of arthritis and septic shock.{{cite journal | vauthors = Nakamura M, Shimizu Y, Sato Y, Miyazaki Y, Satoh T, Mizuno M, Kato Y, Hosaka Y, Furusako S | display-authors = 6 | title = Toll-like receptor 4 signal transduction inhibitor, M62812, suppresses endothelial cell and leukocyte activation and prevents lethal septic shock in mice | journal = European Journal of Pharmacology | volume = 569 | issue = 3 | pages = 237–43 | date = August 2007 | pmid = 17588563 | doi = 10.1016/j.ejphar.2007.05.013 }}{{cite journal | vauthors = Park H, Hong J, Yin Y, Joo Y, Kim Y, Shin J, Kwon HH, Shin N, Shin HJ, Beom J, Kim DW, Kim J | display-authors = 6 | title = TAP2, a peptide antagonist of Toll-like receptor 4, attenuates pain and cartilage degradation in a monoiodoacetate-induced arthritis rat model | journal = Scientific Reports | volume = 10 | issue = 1 | pages = 17451 | date = October 2020 | pmid = 33060735 | doi = 10.1038/s41598-020-74544-5 | pmc = 7567100 | bibcode = 2020NatSR..1017451P | doi-access = free }}