MCHB-1

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-(4-ethoxybenzyl)-1-(cyclohexylmethyl)-N,N-diethyl-1H-benzo[d]imidazole-5-carboxamide

| image = MCHB-1_structure.png

| image_class = skin-invert-image

| width = 220

| tradename =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_US_comment =

| routes_of_administration =

| CAS_number = 1046140-32-2

| PubChem = 44561533

| ChemSpiderID =

| ChEMBL = 470965

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W8QNY2T4YC

| C=28 | H=37 | N=3 | O=2

| smiles = CCN(CC)C(=O)C1=CC2=C(C=C1)N(C(=N2)CC3=CC=C(C=C3)OCC)CC4CCCCC4

| StdInChI = 1S/C28H37N3O2/c1-4-30(5-2)28(32)23-14-17-26-25(19-23)29-27(31(26)20-22-10-8-7-9-11-22)18-21-12-15-24(16-13-21)33-6-3/h12-17,19,22H,4-11,18,20H2,1-3H3

| StdInChIKey = WRVZBXHTUOPQJS-UHFFFAOYSA-N

}}

MCHB-1 is a benzimidazole derived drug which was researched as an analgesic but never developed for medical use. It acts as a potent agonist of the CB₂ receptor, with an EC₅₀ of 0.52nM at CB₂, and ~30x selectivity over CB₁ (Ki of 110nM at CB₁ vs 3.7nM at CB₂).{{cite journal | vauthors = Pagé D, Balaux E, Boisvert L, Liu Z, Milburn C, Tremblay M, Wei Z, Woo S, Luo X, Cheng YX, Yang H, Srivastava S, Zhou F, Brown W, Tomaszewski M, Walpole C, Hodzic L, St-Onge S, Godbout C, Salois D, Payza K, Payza K | display-authors = 6 | title = Novel benzimidazole derivatives as selective CB2 agonists | journal = Bioorganic & Medicinal Chemistry Letters | volume = 18 | issue = 13 | pages = 3695–700 | date = July 2008 | pmid = 18522867 | doi = 10.1016/j.bmcl.2008.05.073 }}{{cite journal | vauthors = Yu XH, Cao CQ, Martino G, Puma C, Morinville A, St-Onge S, Lessard E, Perkins MN, Laird JM | s2cid = 27731273 | display-authors = 6 | title = A peripherally restricted cannabinoid receptor agonist produces robust anti-nociceptive effects in rodent models of inflammatory and neuropathic pain | journal = Pain | volume = 151 | issue = 2 | pages = 337–44 | date = November 2010 | pmid = 20696525 | doi = 10.1016/j.pain.2010.07.019 }} It has been sold online as a designer drug, first being identified in Germany in December 2013.{{cite journal | vauthors = Westphal F, Sönnichsen FD, Knecht S, Auwärter V, Huppertz L | title = Two thiazolylindoles and a benzimidazole: novel compounds on the designer drug market with potential cannabinoid receptor activity | journal = Forensic Science International | volume = 249 | pages = 133–47 | date = April 2015 | pmid = 25698514 | doi = 10.1016/j.forsciint.2015.01.014 }}