MCPB

{{distinguish|meta-Chloroperoxybenzoic acid}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424776569

| ImageFile = MCPB.png

| ImageSize = 220px

| ImageAlt = Skeletal formula of MCPB

| ImageFile1 = MCPB molecule ball.png

| ImageSize1 = 220px

| ImageAlt1 = Ball-and-stick model of the MCPB molecule

| PIN=4-(4-Chloro-2-methylphenoxy)butanoic acid

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=94-81-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = OA1Z4N1842

| PubChem=7207

| SMILES=CC1=C(C=CC(=C1)Cl)OCCCC(=O)O

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 6938

| InChI = 1/C11H13ClO3/c1-8-7-9(12)4-5-10(8)15-6-2-3-11(13)14/h4-5,7H,2-3,6H2,1H3,(H,13,14)

| InChIKey = LLWADFLAOKUBDR-UHFFFAOYAB

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C11H13ClO3/c1-8-7-9(12)4-5-10(8)15-6-2-3-11(13)14/h4-5,7H,2-3,6H2,1H3,(H,13,14)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = LLWADFLAOKUBDR-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Formula=C11H13ClO3

| MolarMass=228.67 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

MCPB, 2,4-MCPB, 4-(4-chloro-o-tolyloxy)butyric acid (IUPAC), or 4-(4-chloro-2-methylphenoxy)butanoic acid (CAS) is a phenoxybutyric herbicide. In the United States it is registered for use on pea crops before flowering, for post-emergence control of broadleaf annual and perennial weeds including Canadian thistle, buttercup, mustard, purslane, ragweed, common lambsquarters, pigweed, smartweed, sowthistle, and morning glory. It has low to moderate acute toxicity, with kidney and liver effects as the main hazard concerns. It is not volatile, persistent, or likely to bioconcentrate.

A variety of methods have been developed for its analysis.{{cite journal|title=Solid-phase extraction of acidic herbicides|author1=Wells, M. J. M. |author2=Yu, L. Z. |journal=Journal of Chromatography A|year=2000|volume=885|issue=1–2

|pages=237–250|doi=10.1016/S0021-9673(00)00206-5|pmid=10941675

}} In the U.S., the maximum residue permitted on peas is 0.1 parts per million.{{cite web|url=http://www.epa.gov/oppsrrd1/REDs/factsheets/mcpb_fs.htm|title= RED FACTS; MCPB|publisher=US EPA}}

References

{{reflist}}