MDMB-FUBICA

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = methyl (2S)-2-({1-[(4-fluorophenyl)methyl]-1H-indol-3-yl}formamido)-3,3-dimethylbutanoate

| image = MDMB_FUBICA.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA = Schedule II

| legal_DE = NpSG

| legal_UK = Class B

| legal_US =

| legal_status = Illegal in Sweden

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 1971007-91-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K53ZMB4NR6

| ATC_prefix =

| ATC_suffix =

| PubChem = 129522107

| ChemSpiderID = 57621561

| smiles = COC(=O)[C@@H](NC(=O)c1cn(Cc2ccc(F)cc2)c3ccccc13)C(C)(C)C

| StdInChI = 1S/C23H25FN2O3/c1-23(2,3)20(22(28)29-4)25-21(27)18-14-26(19-8-6-5-7-17(18)19)13-15-9-11-16(24)12-10-15/h5-12,14,20H,13H2,1-4H3,(H,25,27)/t20-/m1/s1

| StdInChIKey = RVAWIZIGOSKPBP-HXUWFJFHSA-N

| C=23 | H=25 | F=1 | N=2 | O=3

| molecular_weight =

}}

MDMB-FUBICA is an indole-based synthetic cannabinoid that is presumed to be a potent agonist of the CB₁ receptor and has been sold online as a designer drug.{{cite journal | vauthors = Wagmann L, Stiller RG, Fischmann S, Westphal F, Meyer MR | title = Going deeper into the toxicokinetics of synthetic cannabinoids: in vitro contribution of human carboxylesterases | journal = Archives of Toxicology | volume = 96 | issue = 10 | pages = 2755–2766 | date = October 2022 | pmid = 35788413 | pmc = 9352624 | doi = 10.1007/s00204-022-03332-z }}

It was first detected by the EMCDDA in Sweden in February 2015.{{cite web | url=http://drogfokuszpont.hu/wp-content/uploads/NFP_hirlevel_2015_majus.pdf | title = Hamarosan: 2015. Évi Európai Kábítószer - Jelentés | trans-title = Coming soon: 2015. Annual European Drugs - Report | publisher=Hungarian National Focal Point (NFP) | date=June 2015 | access-date=23 July 2015}} It is often sold in e-liquid form for use in an electronic cigarette.{{cite journal | vauthors = Peace MR, Krakowiak RI, Wolf CE, Poklis A, Poklis JL | title = Identification of MDMB-FUBINACA in commercially available e-liquid formulations sold for use in electronic cigarettes | journal = Forensic Science International | volume = 271 | pages = 92–97 | date = February 2017 | pmid = 28076838 | pmc = 5511053 | doi = 10.1016/j.forsciint.2016.12.031 }}