MDPCP

{{Short description|Chemical compound}}

{{drugbox

| image = MDPCP_structure.png

| image_class = skin-invert-image

| legal_UK =

| legal_DE =

| C = 18 | H = 25 | N = 1 | O = 2

| IUPAC_name =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 3034185-93-5

| ChEMBL =

| ChemSpiderID =

| PubChem = 165360308  

| UNII =

| smiles = C1CCC(CC1)(N1CCCCC1)c1ccc2c(c1)OCO2

| StdInChI = 1S/C18H25NO2/c1-3-9-18(10-4-1,19-11-5-2-6-12-19)15-7-8-16-17(13-15)21-14-20-16/h7-8,13H,1-6,9-12,14H2

| StdInChIKey = ANUGFLCSICVCSB-UHFFFAOYSA-N

}}

Methylenedioxyphencyclidine (3',4'-MD-PCP, MDPCP) is a recreational designer drug with dissociative effects. It is an arylcyclohexylamine derivative, with similar effects to related drugs such as 3-MeO-PCP and 4-MeO-PCP.{{cite thesis | url = https://www.proquest.com/openview/f39ec7bec2c272012bb60a1b4581ab68/1?pq-origsite=gscholar&cbl=18750 | vauthors = Wallach JV | title = Structure activity relationship (SAR) studies of arylcycloalkylamines as N-methyl-D-aspartate receptor antagonists. | degree = Ph.D. | publisher = University of the Sciences in Philadelphia. | via = ProQuest Dissertations Publishing | date = 2014 | id = 3690548 }}{{cite book | vauthors = Wallach J, Brandt SD | title = New Psychoactive Substances | chapter = Phencyclidine-Based New Psychoactive Substances | series = Handbook of Experimental Pharmacology | volume = 252 | pages = 261–303 | date = 2018 | pmid = 30105474 | doi = 10.1007/164_2018_124 | isbn = 978-3-030-10560-0 }}