MFZ 10-7

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-Fluoro-5-((6-methylpyridin-2-yl)ethynyl)benzonitrile

| image = MFZ 10-7.svg

| alt = Skeletal formula

| width = 200

| ChemSpiderID = 26334163

| ChEMBL = 1784608

| CAS_number = 1224431-15-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = FV36HKQ9RA

| chemical_formula = C15H9FN2

| C= | H= | As= | Au= | Br= | Cl= | Co= | F= | Gd= | I= | Mn=

| N= | Na= | O= | P= | Pt= | S= | Se= | Sr= | Tc= | Zn= | charge=

| molecular_weight = 236.244

| smiles = Cc1cccc(n1)C#Cc2cc(cc(c2)F)C#N

| StdInChI = 1S/C15H9FN2/c1-11-3-2-4-15(18-11)6-5-12-7-13(10-17)9-14(16)8-12/h2-4,7-9H,1H3

| StdInChIKey = ZGEXQIMQZVRTDZ-UHFFFAOYSA-N

}}

MFZ 10-7 (3-fluoro-5-((6-methylpyridin-2-yl)ethynyl)benzonitrile) is a drug with potential applications in the treatment of addiction, which acts as a negative allosteric modulator of the metabotropic glutamate receptor subtype 5 (mGluR5). Others of the kind, namely MPEP and MTEP, are not considered to have translational potential for human use due to off-target effects and short half-lives. Drugs of this kind have been used to offset craving for drugs of abuse such as cocaine in in vivo animal administration models.{{cite journal | vauthors = Keck TM, Zou MF, Bi GH, Zhang HY, Wang XF, Yang HJ, Srivastava R, Gardner EL, Xi ZX, Newman AH | display-authors = 6 | title = A novel mGluR5 antagonist, MFZ 10-7, inhibits cocaine-taking and cocaine-seeking behavior in rats | journal = Addiction Biology | volume = 19 | issue = 2 | pages = 195–209 | date = March 2014 | pmid = 24001208 | pmc = 3942387 | doi = 10.1111/adb.12086 }}

See also

References

{{Reflist|30em}}

{{Metabotropic glutamate receptor modulators}}

Category:MGlu5 receptor antagonists

Category:Glutamate receptor negative allosteric modulators