MG132

{{Use dmy dates|date=November 2023}}

{{more footnotes needed|date=November 2015}}

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 446613982

| ImageFile = MG132.svg

| ImageSize = 250px

| SystematicName = Benzyl [(2S)-4-methyl-1-{[(2S)-4-methyl-1-{[(2S)-4-methyl-1-oxopentan-2-yl]amino}-1-oxopentan-2-yl]amino}-1-oxopentan-2-yl]carbamate

| OtherNames = N-Benzyloxycarbonyl-L-leucyl-L-leucyl-L-leucinal
Z-Leu-Leu-Leu-al

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 133407-82-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RF1P63GW3K

| PubChem = 462382

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 406728

| SMILES = CC(C)C[C@@H](C=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C26H41N3O5/c1-17(2)12-21(15-30)27-24(31)22(13-18(3)4)28-25(32)23(14-19(5)6)29-26(33)34-16-20-10-8-7-9-11-20/h7-11,15,17-19,21-23H,12-14,16H2,1-6H3,(H,27,31)(H,28,32)(H,29,33)/t21-,22-,23-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = TZYWCYJVHRLUCT-VABKMULXSA-N}}

| Section2 = {{Chembox Properties

| C=26 | H=41 | N=3 | O=5

| Appearance = White solid

| SolubleOther = 100 mM in EtOH and DMSO}}

}}

MG132 is a potent, reversible, and cell-permeable proteasome inhibitor{{Cite journal|last1=Lee|first1=Do Hee|last2=Goldberg|first2=Alfred L|date=October 1998|title=Proteasome inhibitors: valuable new tools for cell biologists|journal=Trends in Cell Biology|language=en|volume=8|issue=10|pages=397–403|doi=10.1016/S0962-8924(98)01346-4|pmid=9789328}} (K_i = 4 nM). It belongs to the class of synthetic peptide aldehydes.{{cite journal | vauthors = Ito A, Takahashi R, Muira C, Baba Y | title = Synthetic Study of Peptide Aldehydes | journal = Chemical and Pharmaceutical Bulletin | volume = 12 | issue = 23 | pages = 3106–3113 | date = 1975 | doi = 10.1248/cpb.23.3106 | doi-access = free }}{{cite journal | vauthors = Hayashi M, Saito Y, Kawashima S | title = Calpain activation is essential for membrane fusion of erythrocytes in the presence of exogenous Ca2+. | journal = Biochem Biophys Res Commun | volume = 182 | issue = 2 | pages = 939–946 | date = 31 January 1992 | pmid = 1734892 | doi=10.1016/0006-291x(92)91822-8}} It reduces the degradation of ubiquitin-conjugated proteins in mammalian cells and permeable strains of yeast by the 26S complex without affecting its ATPase or isopeptidase activities. MG132 activates c-Jun N-terminal kinase (JNK1), which initiates apoptosis. MG132 also inhibits NF-κB activation with an IC₅₀ of 3 μM and prevents β-secretase cleavage.