MK-8189

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = MK-8189.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Investigational

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 1424371-93-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7M430JI73B

| PubChem = 71271414

| DrugBank =

| ChemSpiderID = 128922007

| StdInChI=1S/C19H22N6OS/c1-11-4-5-16(20-8-11)15-6-14(15)10-26-18-7-17(22-12(2)23-18)21-9-19-25-24-13(3)27-19/h4-5,7-8,14-15H,6,9-10H2,1-3H3,(H,21,22,23)/t14-,15+/m1/s1

| StdInChIKey = WQKPZDLZRFTMTI-CABCVRRESA-N

| SMILES = CC1=CN=C(C=C1)[C@H]2C[C@@H]2COC3=NC(=NC(=C3)NCC4=NN=C(S4)C)C

| IUPAC_name = 2-Methyl-6-[[(1S,2S)-2-(5-methylpyridin-2-yl)cyclopropyl]methoxy]-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidin-4-amine

| C = 19 | H = 22 | N = 6 | O = 1 | S =1

}}

MK-8189 is a selective phosphodiesterase 10A inhibitor being developed for schizophrenia. It is developed by Merck in collaboration with Royalty Pharma.{{cite journal |last1=Mukai |first1=Yuki |last2=Lupinacci |first2=Robert |last3=Marder |first3=Stephen |last4=Mackle |first4=Mary |last5=Snow-Adami |first5=Linda |last6=Voss |first6=Tiffini |last7=Smith |first7=Sean |last8=Egan |first8=Michael |title=P534. Initial Assessment of the Clinical Profile of the PDE10A Inhibitor MK-8189 in Patients With an Acute Episode of Schizophrenia |journal=Biological Psychiatry |date=May 2022 |volume=91 |issue=9 |pages=S305 |doi=10.1016/j.biopsych.2022.02.771|s2cid=248410630 }}{{cite journal |last1=Smith |first1=Sean |last2=Uslaner |first2=Jason |last3=Kandebo |first3=Monika |last4=Hostetler |first4=Eric |last5=Raheem |first5=Izzat |last6=Layton |first6=Mark |last7=Gantert |first7=Liza |last8=Riffel |first8=Kerry |last9=Cox |first9=Christopher |last10=Khalilieh |first10=Sauzanne |last11=De Lepeleire |first11=Inge |last12=Bormans |first12=Guy |last13=Depré |first13=Marleen |last14=de Hoon |first14=Jan |last15=Van Laere |first15=Koen |title=P546. Preclinical Characterization and Phase 1 Evaluation of the Tolerability, Pharmacokinetics, and Enzyme Occupancy of MK-8189, a Novel PDE10A Inhibitor |journal=Biological Psychiatry |date=May 2022 |volume=91 |issue=9 |pages=S309–S310 |doi=10.1016/j.biopsych.2022.02.783|s2cid=248410556 }}{{cite journal |last1=Layton |first1=Mark E. |last2=Kern |first2=Jeffrey C. |last3=Hartingh |first3=Timothy J. |last4=Shipe |first4=William D. |last5=Raheem |first5=Izzat |last6=Kandebo |first6=Monika |last7=Hayes |first7=Robert P. |last8=Huszar |first8=Sarah |last9=Eddins |first9=Donnie |last10=Ma |first10=Bennett |last11=Fuerst |first11=Joy |last12=Wollenberg |first12=Gordon K. |last13=Li |first13=Jing |last14=Fritzen |first14=Jeff |last15=McGaughey |first15=Georgia B. |last16=Uslaner |first16=Jason M. |last17=Smith |first17=Sean M. |last18=Coleman |first18=Paul J. |last19=Cox |first19=Christopher D. |title=Discovery of MK-8189, a Highly Potent and Selective PDE10A Inhibitor for the Treatment of Schizophrenia |journal=Journal of Medicinal Chemistry |date=26 January 2023 |volume=66 |issue=2 |pages=1157–1171 |doi=10.1021/acs.jmedchem.2c01521|pmid=36624931 |s2cid=255567942 |doi-access=free |pmc=9884086 }}{{cite journal |title=MK-8189: A Potent and Selective PDE10A Inhibitor for the Treatment of Schizophrenia |journal=Synfacts |date=April 2023 |volume=19 |issue=4 |pages=0410 |doi=10.1055/s-0042-1752651|s2cid=257614478 }}