ML-154
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 3-(Diphenylphosphinothioyl)-2-methyl-1-[(2E)-3-phenyl-2-propen-1-yl]imidazo[1,2-a]pyridinium bromide
| image = ML-154.svg
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| IUPHAR_ligand =
| CAS_number = 1345964-89-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = QF6BKX96N5
| ATC_prefix = none
| ATC_suffix =
| PubChem = 46930969
| ChemSpiderID = 26360842
| C=29 | H=26 | Br=1 | N=2 | P=1 | S=1
| smiles = [Br-].C1(=CC=CC=C1)[P](=S)(C2=C([N+](=C3C=CC=C[N]23)C\C=C\C4=CC=CC=C4)C)C5=CC=CC=C5
| StdInChI = 1S/C29H26N2PS.BrH/c1-24-29(32(33,26-17-7-3-8-18-26)27-19-9-4-10-20-27)31-22-12-11-21-28(31)30(24)23-13-16-25-14-5-2-6-15-25;/h2-22H,23H2,1H3;1H/q+1;/p-1/b16-13+;
| StdInChIKey = CJAQCMBWGUOBIX-ZUQRMPMESA-M
}}
ML-154 (NCGC-84) is a drug which acts as a selective, non-peptide antagonist at the neuropeptide S receptor NPSR.{{cite journal | vauthors = Patnaik S, Marugan JJ, Liu K, Zheng W, Southall N, Dehdashti SJ, Thorsell A, Heilig M, Bell L, Zook M, Eskay B, Brimacombe KR, Austin CP | display-authors = 6 | title = Structure-activity relationship of imidazopyridinium analogues as antagonists of neuropeptide s receptor | journal = Journal of Medicinal Chemistry | volume = 56 | issue = 22 | pages = 9045–56 | date = November 2013 | pmid = 24171469 | doi = 10.1021/jm400904m | pmc = 4877059 }} In animal studies it decreases self-administration of alcohol in addicted rats, and lowers motivation for alcohol rewards, suggesting a potential application for NPS antagonists in the treatment of alcoholism.{{cite journal | vauthors = Thorsell A, Tapocik JD, Liu K, Zook M, Bell L, Flanigan M, Patnaik S, Marugan J, Damadzic R, Dehdashti SJ, Schwandt ML, Southall N, Austin CP, Eskay R, Ciccocioppo R, Zheng W, Heilig M | display-authors = 6 | title = A novel brain penetrant NPS receptor antagonist, NCGC00185684, blocks alcohol-induced ERK-phosphorylation in the central amygdala and decreases operant alcohol self-administration in rats | journal = The Journal of Neuroscience | volume = 33 | issue = 24 | pages = 10132–42 | date = June 2013 | pmid = 23761908 | doi = 10.1523/JNEUROSCI.4742-12.2013 | pmc = 3682378 | doi-access = free }}
See also
References
{{Reflist|2}}
Category:Organophosphorus compounds
Category:Quaternary ammonium compounds
{{nervous-system-drug-stub}}