ML-SI3

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-[(1S,2S)-2-[4-(2-methoxyphenyl)piperazin-1-yl]cyclohexyl]benzenesulfonamide

| image = ML-SI3_structure.png

| width = 220

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number = 891016-02-7

| PubChem = 94784693

| ChemSpiderID = 20304221

| ChEMBL =

| UNII =

| C=23 | H=31 | N=3 | O=3 | S=1

| smiles = COC1=CC=CC=C1N2CCN(CC2)[C@H]3CCCC[C@@H]3NS(=O)(=O)C4=CC=CC=C4

| StdInChI = 1S/C23H31N3O3S/c1-29-23-14-8-7-13-22(23)26-17-15-25(16-18-26)21-12-6-5-11-20(21)24-30(27,28)19-9-3-2-4-10-19/h2-4,7-10,13-14,20-21,24H,5-6,11-12,15-18H2,1H3/t20-,21-/m0/s1

| StdInChIKey = OVTXOMMQHRIKGL-SFTDATJTSA-N

}}

ML-SI3 is a chemical compound which acts as an "antagonist" (i.e. channel blocker) of the TRPML family of calcium channels, with greatest activity at the TRPML1 channel, although it also blocks the related TRPML2 and TRPML3 channels with lower affinity. It is used for research into the role of TRPML1 and its various functions in lysosomes and elsewhere in the body.{{cite journal | vauthors = Kilpatrick BS, Yates E, Grimm C, Schapira AH, Patel S | title = Endo-lysosomal TRP mucolipin-1 channels trigger global ER Ca2+ release and Ca2+ influx | journal = Journal of Cell Science | volume = 129 | issue = 20 | pages = 3859–3867 | date = October 2016 | pmid = 27577094 | doi = 10.1242/jcs.190322 | doi-access = free | pmc = 5087663 }}{{cite journal | vauthors = Li X, Rydzewski N, Hider A, Zhang X, Yang J, Wang W, Gao Q, Cheng X, Xu H | display-authors = 6 | title = A molecular mechanism to regulate lysosome motility for lysosome positioning and tubulation | journal = Nature Cell Biology | volume = 18 | issue = 4 | pages = 404–17 | date = April 2016 | pmid = 26950892 | doi = 10.1038/ncb3324 | pmc = 4871318 | hdl = 2027.42/120892 | hdl-access = free }}{{cite journal | vauthors = Sahoo N, Gu M, Zhang X, Raval N, Yang J, Bekier M, Calvo R, Patnaik S, Wang W, King G, Samie M, Gao Q, Sahoo S, Sundaresan S, Keeley TM, Wang Y, Marugan J, Ferrer M, Samuelson LC, Merchant JL, Xu H | display-authors = 6 | title = 2+ Efflux Channel in the Tubulovesicle | journal = Developmental Cell | volume = 41 | issue = 3 | pages = 262–273.e6 | date = May 2017 | pmid = 28486130 | doi = 10.1016/j.devcel.2017.04.003 | doi-access = free | pmc = 5497767 }}{{cite journal | vauthors = Scotto Rosato A, Montefusco S, Soldati C, Di Paola S, Capuozzo A, Monfregola J, Polishchuk E, Amabile A, Grimm C, Lombardo A, De Matteis MA, Ballabio A, Medina DL | title = TRPML1 links lysosomal calcium to autophagosome biogenesis through the activation of the CaMKKβ/VPS34 pathway | journal = Nature Communications | volume = 10 | issue = 1 | pages = 5630 | date = December 2019 | pmid = 31822666 | pmc = 6904751 | doi = 10.1038/s41467-019-13572-w | bibcode = 2019NatCo..10.5630S }}{{cite journal | vauthors = Zhang X, Chen W, Gao Q, Yang J, Yan X, Zhao H, Su L, Yang M, Gao C, Yao Y, Inoki K, Li D, Shao R, Wang S, Sahoo N, Kudo F, Eguchi T, Ruan B, Xu H | display-authors = 6 | title = Rapamycin directly activates lysosomal mucolipin TRP channels independent of mTOR | journal = PLOS Biology | volume = 17 | issue = 5 | pages = e3000252 | date = May 2019 | pmid = 31112550 | doi = 10.1371/journal.pbio.3000252|pmc=6528971 | doi-access = free }}{{cite journal | vauthors = Li D, Shao R, Wang N, Zhou N, Du K, Shi J, Wang Y, Zhao Z, Ye X, Zhang X, Xu H | display-authors = 6 | title = Sulforaphane Activates a lysosome-dependent transcriptional program to mitigate oxidative stress | journal = Autophagy | pages = 872–887 | date = March 2020 | volume = 17 | issue = 4 | pmid = 32138578 | doi = 10.1080/15548627.2020.1739442 | pmc = 8078734 }}{{cite journal | vauthors = Leser C, Keller M, Gerndt S, Urban N, Chen CC, Schaefer M, Grimm C, Bracher F | title = Chemical and pharmacological characterization of the TRPML calcium channel blockers ML-SI1 and ML-SI3. | journal = European Journal of Medicinal Chemistry | date = October 2020 | volume = 210 | pages = 112966 | doi = 10.1016/j.ejmech.2020.112966 | pmid = 33187805 }}

See also

References

{{Reflist}}

{{Transient receptor potential channel modulators}}

Category:Sulfonamides

Category:Phenylpiperazines