MRS-1706
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 450847712
| ImageFile=MRS-1706.svg
| ImageSize=260px
| IUPACName=N-(4-Acetylphenyl)-2-[4-(2,3,6,7-tetrahydro-2,6-dioxo-1,3-dipropyl-1H-purin-8-yl)phenoxy]acetamide
| OtherNames=MRS 1706
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 3287
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=264622-53-9
| PubChem = 5139184
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4313008
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = YEE5LME5K5
| InChI = 1/C27H29N5O5/c1-4-14-31-25-23(26(35)32(15-5-2)27(31)36)29-24(30-25)19-8-12-21(13-9-19)37-16-22(34)28-20-10-6-18(7-11-20)17(3)33/h6-13H,4-5,14-16H2,1-3H3,(H,28,34)(H,29,30)
| InChIKey = ZKUCFFYOQOJLGT-UHFFFAOYAX
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C27H29N5O5/c1-4-14-31-25-23(26(35)32(15-5-2)27(31)36)29-24(30-25)19-8-12-21(13-9-19)37-16-22(34)28-20-10-6-18(7-11-20)17(3)33/h6-13H,4-5,14-16H2,1-3H3,(H,28,34)(H,29,30)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = ZKUCFFYOQOJLGT-UHFFFAOYSA-N
| RTECS =
| MeSHName = C496145
| SMILES=CCCN1C2=C(C(=O)N(C1=O)CCC)NC(=N2)C3=CC=C(C=C3)OCC(=O)NC4=CC=C(C=C4)C(=O)C
}}
|Section2={{Chembox Properties
| Formula=C27H29N5O5
| MolarMass=503.56
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
MRS-1706 is a selective inverse agonist for the adenosine A2B receptor.{{cite journal | vauthors = Li Q, Ye K, Blad CC, den Dulk H, Brouwer J, Ijzerman AP, Beukers MW | title = ZM241385, DPCPX, MRS1706 are inverse agonists with different relative intrinsic efficacies on constitutively active mutants of the human adenosine A2B receptor | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 320 | issue = 2 | pages = 637–45 | date = February 2007 | pmid = 17077318 | doi = 10.1124/jpet.106.111203 }} It inhibits release of interleukins and has an antiinflammatory effect.{{cite journal | vauthors = Vazquez JF, Clement HW, Sommer O, Schulz E, van Calker D | title = Local stimulation of the adenosine A2B receptors induces an increased release of IL-6 in mouse striatum: an in vivo microdialysis study | journal = Journal of Neurochemistry | volume = 105 | issue = 3 | pages = 904–9 | date = May 2008 | pmid = 18088370 | doi = 10.1111/j.1471-4159.2007.05191.x | doi-access = free }}{{cite journal | vauthors = Ryzhov S, Zaynagetdinov R, Goldstein AE, Novitskiy SV, Dikov MM, Blackburn MR, Biaggioni I, Feoktistov I | display-authors = 6 | title = Effect of A2B adenosine receptor gene ablation on proinflammatory adenosine signaling in mast cells | journal = Journal of Immunology | volume = 180 | issue = 11 | pages = 7212–20 | date = June 2008 | pmid = 18490720 | pmc=3628765| doi = 10.4049/jimmunol.180.11.7212 | doi-access = free }}