Magnesium pidolate
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 400295046
| IUPAC_name = Magnesium 5-oxopyrrolidine-2-carboxylate
| image = magnesium pidolate.png
| tradename =
| Drugs.com = {{drugs.com|CDI|magnesium_pidolate}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 135701-98-3
| ATC_prefix = A12
| ATC_suffix = CC08
| PubChem = 9838620
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8014340
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = V5PC588N7G
| C=10 | H=12 | N=2 | Mg=1 | O=6
| smiles = [Mg+2].[O-]C(=O)C1NC(=O)CC1.[O-]C(=O)C1NC(=O)CC1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/2C5H7NO3.Mg/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H,6,7)(H,8,9);/q;;+2/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JQAACYUZYRBHGG-UHFFFAOYSA-L
}}
Magnesium pidolate, the magnesium salt of pidolic acid (also known as pyroglutamic acid), is a mineral supplement, which contains 8.6% magnesium w/w.
External links
- {{cite journal |vauthors=De Franceschi L, Bachir D, Galacteros F, etal |title=Oral magnesium pidolate: effects of long-term administration in patients with sickle cell disease |journal=Br. J. Haematol. |volume=108 |issue=2 |pages=284–9 |year=2000 |pmid=10691856 |doi=10.1046/j.1365-2141.2000.01861.x|s2cid=36974114 |doi-access= }}
{{Mineral supplements}}
{{gastrointestinal-drug-stub}}