Magnesium pidolate

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 400295046

| IUPAC_name = Magnesium 5-oxopyrrolidine-2-carboxylate

| image = magnesium pidolate.png

| tradename =

| Drugs.com = {{drugs.com|CDI|magnesium_pidolate}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 135701-98-3

| ATC_prefix = A12

| ATC_suffix = CC08

| PubChem = 9838620

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8014340

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V5PC588N7G

| C=10 | H=12 | N=2 | Mg=1 | O=6

| smiles = [Mg+2].[O-]C(=O)C1NC(=O)CC1.[O-]C(=O)C1NC(=O)CC1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/2C5H7NO3.Mg/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H,6,7)(H,8,9);/q;;+2/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JQAACYUZYRBHGG-UHFFFAOYSA-L

}}

Magnesium pidolate, the magnesium salt of pidolic acid (also known as pyroglutamic acid), is a mineral supplement, which contains 8.6% magnesium w/w.