Manganese(II) acetate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 486589107

| Name = Manganese(II) acetate

| ImageFile = Manganese acetate.png

| ImageSize =

| ImageName =

| IUPACName = Manganese(II) acetate

| OtherNames = Manganese diacetate

| Reference =

{{Citation

| last = Lide

| first = David R.

| author-link =

| publication-date =

| year = 1998

| title = Handbook of Chemistry and Physics

| edition = 87

| volume =

| series =

| publication-place = Boca Raton, FL

| place =

| publisher = CRC Press

| id =

| isbn = 0-8493-0594-2

| doi =

| oclc =

| pages = 3–354, 4–68

| url =

| accessdate =

}}

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 638-38-0

| CASNo_Comment = (anhydrous)

| CASNo2_Ref = {{cascite|changed|??}}

| CASNo2 = 19513-05-4

| CASNo2_Comment = (dihydrate)

| CASNo3_Ref = {{cascite|correct|CAS}}

| CASNo3 = 6156-78-1

| CASNo3_Comment = (tetrahydrate)

| UNII_Ref = {{cascite|correct|CAS}}

| UNII = 0V6E9Q2I0Y

| UNII_Comment = (anhydrous)

| UNII3_Ref = {{fdacite|correct|FDA}}

| UNII3 = 9TO51D176N

| UNII3_Comment = (tetrahydrate)

| SMILES = CC([O-])=O.CC([O-])=O.[Mn+2]

| RTECS =

| EINECS =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 12008

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/2C2H4O2.Mn/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UOGMEBQRZBEZQT-UHFFFAOYSA-L

| PubChem = 12525

}}

|Section2={{Chembox Properties

| Formula = {{chem2|Mn(CH3CO2)2}} (anhydrous)
{{chem2|Mn(CH3CO2)2*4H2O}} (tetrahydrate)

| MolarMass = 173.027 g/mol (anhydrous)
245.087 g/mol (tetrahydrate)

| Appearance = white crystals (anhydrous)
light pink monoclinic crystals (tetrahydrate)

| Density = 1.74 g/cm³ (anhydrous)
1.59 g/cm³ (tetrahydrate)

| MeltingPtC = 210

| MeltingPt_notes = (anhydrous)
80 °C (tetrahydrate)

| BoilingPt =

| SolubleOther = soluble in water (about 700g/L at 20°C for tetrahydrate), methanol, acetic acid (anhydrous)
soluble in water, ethanol (tetrahydrate)

| MagSus = +13,650·10⁻⁶ cm³/mol

}}

|Section3={{Chembox Structure

| Coordination =

| CrystalStruct =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| NFPA-H = 1

| NFPA-F = 0

| NFPA-R = 0

| FlashPt = >

| FlashPtC = 130

| FlashPt_notes = (tetrahydrate)

| LD50 = 2940 mg/kg (rat, oral){{IDLH|7439965|Manganese compounds (as Mn)}}

}}

|Section8={{Chembox Related

| OtherAnions = Manganese(II) fluoride
Manganese(II) chloride
Manganese(II) bromide

| OtherCations = Zinc acetate
Mercury(II) acetate
Silver acetate

}}

}}

Manganese(II) acetate are chemical compounds with the formula {{chem2|Mn(CH3CO2)2*(H2O)n}} where n = 0, 2, 4. These materials are white or pale pink solids. Some of these compounds are used as a catalyst and as fertilizer.{{Citation

| title = Concise Encyclopedia Chemistry

| author = Thomas Scott

| author2 = Mary Eagleson

| publisher = Walter de Gruyter

| year = 1994

| isbn = 3-11-011451-8

| page = 620

| url = https://books.google.com/books?id=Owuv-c9L_IMC&dq=%22Manganese%28II%29+acetate%22&pg=PA620

| accessdate = 2009-07-20

}}