Mapracorat

{{Short description|Type of selective glucocorticoid receptor agonist}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 406275524

| IUPAC_name = (2R)-1,1,1-trifluoro-4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-4-methyl-2-[[(2-methylquinolin-5-yl)amino]methyl]pentan-2-ol

| image = Mapracorat_skeletal.svg

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Investigational

| routes_of_administration = Topical (ointment, eye drops)

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 887375-26-0

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 24795088

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| KEGG = D10136

| KEGG_Ref = {{keggcite|changed|kegg}}

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 25104194

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 145V79YBVP

| chemical_formula =

| C=25 | H=26 | F=4 | N=2 | O=2

| smiles = c14OCCc4cc(F)cc1C(C)(C)CC(O)(C(F)(F)F)CNc(cccc2n3)c2ccc3C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C25H26F4N2O2/c1-15-7-8-18-20(5-4-6-21(18)31-15)30-14-24(32,25(27,28)29)13-23(2,3)19-12-17(26)11-16-9-10-33-22(16)19/h4-8,11-12,30,32H,9-10,13-14H2,1-3H3/t24-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VJGFOYBQOIPQFY-XMMPIXPASA-N

}}

Mapracorat (INN, code names BOL-303242-X, ZK-245186{{cite journal | vauthors = Cavet ME, Harrington KL, Ward KW, Zhang JZ | title = Mapracorat, a novel selective glucocorticoid receptor agonist, inhibits hyperosmolar-induced cytokine release and MAPK pathways in human corneal epithelial cells | journal = Molecular Vision | volume = 16 | pages = 1791–800 | date = September 2010 | pmid = 20824100 | pmc = 2932489 }}) is an anti-inflammatory drug belonging to the experimental class of selective glucocorticoid receptor agonists (SEGRAs). It is in clinical trials for the topical treatment of atopic dermatitis,{{ClinicalTrialsGov|NCT00944632|Dose Escalation of Different Concentrations of ZK 245186 in Atopic Dermatitis}} inflammation following cataract surgery,{{ClinicalTrialsGov|NCT00905450|Evaluation of BOL-303242-X Versus Vehicle for the Treatment of Inflammation Following Cataract Surgery}} and allergic conjunctivitis.{{ClinicalTrialsGov|NCT01289431|Mapracorat Ophthalmic Formulation in Subjects With Allergic Conjunctivitis}} Preliminary investigation for the treatment of keratoconjunctivitis sicca has been conducted in cellular models.