Mebutamate

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 457633911

| IUPAC_name = 2-sec-Butyl-2-methylpropane-1,3-diyl dicarbamate

| image = Mebutamate.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US = Schedule IV

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 64-55-1

| ATC_prefix = N05

| ATC_suffix = BC04

| PubChem = 6151

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5H8F175RER

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01807

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1200922

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 5919

| C=10 | H=20 | N=2 | O=4

| smiles = CCC(C)C(C)(COC(=O)N)COC(=O)N

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C10H20N2O4/c1-4-7(2)10(3,5-15-8(11)13)6-16-9(12)14/h7H,4-6H2,1-3H3,(H2,11,13)(H2,12,14)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = LEROTMJVBFSIMP-UHFFFAOYSA-N

}}

Mebutamate (Capla, Dormate) is an anxiolytic and sedative drug with antihypertensive effects of the carbamate class.{{cite book | title = Index Nominum 2000: International Drug Directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA634 | date = January 2000 | publisher = Taylor & Francis | isbn = 978-3-88763-075-1 | page = 634}}{{ cite book | title = The Merck Index | edition = 14 | publisher = Merck Publishers | isbn = 978-0-911910-00-1 | at = 5813 | date = 2006-11-03 }} It has effects comparable to those of barbiturates such as secobarbital, but is only around 1/3 the potency of secobarbital as a sedative. Side effects include dizziness and headaches.{{cite journal | vauthors = Tetreault L, Richer P, Bordeleau JM | title = Hypnotic properties of mebutamate: a comparative study of mebutamate, secobarbital and placebo in psychiatric patients | journal = Canadian Medical Association Journal | volume = 97 | issue = 8 | pages = 395–8 | date = August 1967 | pmid = 6037393 | pmc = 1923261 }}

Mebutamate is one of many GABAergic drugs which act via allosteric agonism of the GABAA receptor at the β-subreceptor similar to barbiturates. In contrast, benzodiazepines act at the α-subreceptor. As such, carbamates and barbiturates, possess analgesic properties while the benzodiazepine class of drugs are strictly psychoactive.

Other carbamates with the same mechanism of action and pharmacological properties include meprobamate, carisoprodol, felbamate, and tybamate.

Synthesis

Structural analogs

References

{{Reflist}}

{{Anxiolytics}}

{{GABAAR PAMs}}

Category:Anxiolytics

Category:Carbamates

Category:GABAA receptor positive allosteric modulators

{{sedative-stub}}