Mefexamide

{{Short description|Central nervous system stimulant that is no longer marketed}}

{{Chembox

| ImageFile = Mefexamide.svg

| ImageClass = skin-invert-image

| ImageAlt =

| PIN = N-[2-(Diethylamino)ethyl]-2-(4-methoxyphenoxy)acetamide

| OtherNames = Mefaxadyne

|Section1={{Chembox Identifiers

| CASNo = 1227-61-8

| CASNo_Ref = {{Cascite|changed|CAS}}

| PubChem = 4045

| ChEBI = 92373

| ChEMBL = 1368380

| ChemSpiderID = 3905

| EC_number = 214-963-1

| KEGG = D04894

| UNII = 84FP054Z2Q

| InChI=1S/C15H24N2O3/c1-4-17(5-2)11-10-16-15(18)12-20-14-8-6-13(19-3)7-9-14/h6-9H,4-5,10-12H2,1-3H3,(H,16,18)

| InChIKey= HUNIPYLVUPMFCZ-UHFFFAOYSA-N

| SMILES =CCN(CC)CCNC(=O)COC1=CC=C(C=C1)OC }}

|Section2={{Chembox Properties

| C=15 | H=24 | N=2 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS06}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|300|310|330}}

| PPhrases = {{P-phrases|260|262|264|270|271|280|284|301+310|302+350|304+340|310|320|321|322|330|361|363|403+233|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

|Section4={{Chembox Legal status

| legal_AU =

| legal_BR = C1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_US =

| legal_UK =

| legal_UN =

}}

}}

Mefexamide (INN, USAN) (brand names Perneuron, Peroxinorm, Timodyne; developmental code name ANP-297), also known as mefexadyne and mexephenamide, is a central nervous system stimulant that is no longer marketed.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA761|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=761–}}

See also

References