Meladrazine

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 444563231

| IUPAC_name = N²,N²,N⁴,N⁴-Tetraethyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine

| image = Meladrazine.svg

| alt = Skeletal formula of meladrazine

| image2 = Meladrazine-3D-balls.png

| alt2 = Ball-and-stick model of the meladrazine molecule

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 13957-36-3

| ATC_prefix = G04

| ATC_suffix = BD03

| PubChem = 71679

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2V6Z0JG2X0

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07225

| ChemSpiderID = 64733

| C=11 | H=23 | N=7

| smiles = CCN(CC)C1=NC(=NN)N=C(N1)N(CC)CC

| StdInChI = 1S/C11H23N7/c1-5-17(6-2)10-13-9(16-12)14-11(15-10)18(7-3)8-4/h5-8,12H2,1-4H3,(H,13,14,15,16)

| StdInChIKey = IRQOBYXMACIFKD-UHFFFAOYSA-N

}}

Meladrazine is a drug used in urology as an antispasmodic.{{cite journal | vauthors = Nicholas RS, Friede T, Hollis S, Young CA | title = Anticholinergics for urinary symptoms in multiple sclerosis | journal = The Cochrane Database of Systematic Reviews | volume = | issue = 1 | pages = CD004193 | date = January 2009 | pmid = 19160231 | doi = 10.1002/14651858.CD004193.pub2 | url = }}