Menthyl anthranilate

{{short description|Sunscreening agent}}

{{distinguish|Methyl anthranilate}}

{{Chembox

| ImageFile = Menthyl anthranilate.svg

| ImageSize = 200px

| IUPACName = (1R,3R,4S)-p-Menthan-3-yl 2-aminobenzoate

| SystematicName = (1R,2S,5R)-5-Methyl-2-(propan-2-yl)cyclohexyl 2-aminobenzoate

| OtherNames = Meradimate; Menthyl-o-aminobenzoate; Anthranilic acid menthyl ester; Anthranilic acid p-menth-3-yl ester

|Section1={{Chembox Identifiers

| CASNo = 307556-71-4

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J9QGD60OUZ

| PubChem = 7059574

| ChemSpiderID = 5415748

| SMILES = O=C(O[C@H]1[C@@H](CC[C@H](C1)C)C(C)C)c2ccccc2N

| InChI = 1/C17H25NO2/c1-11(2)13-9-8-12(3)10-16(13)20-17(19)14-6-4-5-7-15(14)18/h4-7,11-13,16H,8-10,18H2,1-3H3/t12-,13+,16-/m1/s1

| InChIKey = SOXAGEOHPCXXIO-DVOMOZLQBB

| StdInChI = 1S/C17H25NO2/c1-11(2)13-9-8-12(3)10-16(13)20-17(19)14-6-4-5-7-15(14)18/h4-7,11-13,16H,8-10,18H2,1-3H3/t12-,13+,16-/m1/s1

| StdInChIKey = SOXAGEOHPCXXIO-DVOMOZLQSA-N

}}

|Section2={{Chembox Properties

| C=17 | H=25 | N=1 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Menthyl anthranilate (meradimate) is a sunscreening agent. It is one of the 17 ingredients approved by the Food and Drug Administration for use in over-the-counter sunscreen products.{{cite web | title = The Skin Cancer Foundation's Guide to Sunscreens | url = http://www.skincancer.org/prevention/sun-protection/sunscreen/the-skin-cancer-foundations-guide-to-sunscreens | publisher = Skin Cancer Foundation | accessdate = March 15, 2013}}{{Cite journal |title=Substituent position effects on sunscreen photodynamics: A closer look at methyl anthranilate |date=2018 |journal=Chemical Physics | doi = 10.1016/j.chemphys.2018.08.001 |last1=Rodrigues |first1=Natércia d.N. |last2=Cole-Filipiak |first2=Neil C. |last3=Turner |first3=Matt A.P. |last4=Krokidi |first4=Konstantina |last5=Thornton |first5=Georgia L. |last6=Richings |first6=Gareth W. |last7=Hine |first7=Nicholas D.M. |last8=Stavros |first8=Vasilios G. |volume=515 |pages=596–602 |bibcode=2018CP....515..596R |doi-access=free }}{{Cite journal |title=Photophysics of the sunscreen ingredient menthyl anthranilate and its precursor methyl anthranilate: A bottom-up approach to photoprotection |date=2018 |url=https://www.sciencedirect.com/science/article/pii/S101060301731434X |journal=Journal of Photochemistry and Photobiology A: Chemistry | doi = 10.1016/j.jphotochem.2017.11.042 |last1=Rodrigues |first1=N.D.N. |last2=Cole-Filipiak |first2=N.C. |last3=Horbury |first3=M.D. |last4=Staniforth |first4=M. |last5=Karsili |first5=T.N.V. |last6=Peperstraete |first6=Y. |last7=Stavros |first7=V.G. |volume=353 |pages=376–384 |bibcode=2018JPPA..353..376R }}