Met-enkephalin

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 458949133

| ImageFile = Met-enkephalin Structure.svg

| ImageClass = skin-invert-image

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageSize = 250px

| ImageFile1 = Met-enkephalin ball-and-stick.png

| ImageClass1 = bg-transparent

| ImageSize1 = 250px

| ImageName = Skeletal formula of Met-enkphalin

| IUPACName = (2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoic acid

| OtherNames = [Met]enkephalin; [Met5]enkephalin; L-Tyrosylglycylglycyl-L-phenylalanyl-L-methionine

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 1614

| CASNo = 58569-55-4

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9JEZ9OD3AS

| PubChem = 443363

| ChemSpiderID = 391597

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| EINECS = 261-335-8

| KEGG = C11684

| KEGG_Ref = {{keggcite|changed|kegg}}

| MeSHName = Enkephalin,+Methionine

| ChEBI = 6618

| ChEMBL = 13786

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| SMILES = CSCCC(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)C(N)Cc1ccc(O)cc1)C(O)=O

| SMILES1 = CSCCC(NC(=O)C(CC1=CC=CC=C1)NC(=O)CNC(=O)CNC(=O)C(N)CC1=CC=C(O)C=C1)C(O)=O

| StdInChI = 1S/C27H35N5O7S/c1-40-12-11-21(27(38)39)32-26(37)22(14-17-5-3-2-4-6-17)31-24(35)16-29-23(34)15-30-25(36)20(28)13-18-7-9-19(33)10-8-18/h2-10,20-22,33H,11-16,28H2,1H3,(H,29,34)(H,30,36)(H,31,35)(H,32,37)(H,38,39)

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = YFGBQHOOROIVKG-UHFFFAOYSA-N

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

}}

|Section2={{Chembox Properties

| C=27 | H=35 | N=5 | S=1 | O=7

| LogP = 0.607

| pKa = 3.234

| pKb = 10.763

}}

}}

Met-enkephalin, also known as metenkefalin (INN), sometimes referred to as opioid growth factor (OGF),{{cite journal |vauthors=Zagon IS, Isayama T, McLaughlin PJ | title = Preproenkephalin mRNA expression in the developing and adult rat brain | journal = Brain Research. Molecular Brain Research | volume = 21 | issue = 1–2 | pages = 85–98 |date=January 1994 | pmid = 8164525 | doi = 10.1016/0169-328x(94)90381-6}} is a naturally occurring, endogenous opioid peptide that has opioid effects of a relatively short duration. It is one of the two forms of enkephalin, the other being leu-enkephalin. The enkephalins are considered to be the primary endogenous ligands of the δ-opioid receptor, due to their high potency and selectivity for the site over the other endogenous opioids.{{cite book | author = Christoph Stein | title = Opioids in pain control: basic and clinical aspects | url = https://books.google.com/books?id=4Rfr8cQayvgC&pg=PA22 | access-date = 25 November 2011 | year = 1999 | publisher = Cambridge University Press | isbn = 978-0-521-62269-1 | pages = 22–23}}

History

Met-enkephalin was discovered and characterized by John Hughes, Hans Kosterlitz, et al. in 1975 after a search for endogenous ligands of the opioid receptors.{{cite book | author = Thomas Carleton Moore | title = Neurovascular immunology: vasoactive neurotransmitters and modulators in cellular immunity and memory | url = https://books.google.com/books?id=dJyJGevjkzQC&pg=PA179 | access-date = 25 November 2011 | year = 1993 | publisher = CRC Press | isbn = 978-0-8493-6894-3 | page = 179}}

Chemistry

Met-enkephalin is a pentapeptide with the amino acid sequence tyr-gly-gly-phe-met. The tyrosine residue at position 1 is thought to be analogous to the 3-hydroxyl group on morphine.{{Citation needed|date=November 2011}}

Biochemistry

= Distribution =

Met-enkephalin is found mainly in the adrenal medulla and throughout the central nervous system (CNS), including in the striatum, cerebral cortex, olfactory tubercle, hippocampus, septum, thalamus, and periaqueductal gray, as well as the dorsal horn of the spinal cord. It is also present in the periphery, notably in some primary afferent fibers that innervate the pelvic viscera.

= Biosynthesis =

Met-enkephalin is synthesized from proenkephalin via proteolytic cleavage{{cite book | author = Fleur L. Strand | title = Neuropeptides: regulators of physiological processes | url = https://archive.org/details/neuropeptidesreg0000stra | url-access = registration | access-date = 25 November 2011 | year = 1999 | publisher = MIT Press | isbn = 978-0-262-19407-5 | page = [https://archive.org/details/neuropeptidesreg0000stra/page/348 348]}} in two metabolic steps. Proenkephalin A is first reduced by either one of two trypsin-like endopeptidase enzymes, prohormone convertase 1 (PC1) or prohormone convertase 2 (PC2); then, the resulting intermediates are further reduced by the enzyme carboxypeptidase E (CPE; previously known as enkephalin convertase (EC)).{{cite journal |vauthors=Costa E, Mocchetti I, Supattapone S, Snyder SH | title = Opioid peptide biosynthesis: enzymatic selectivity and regulatory mechanisms | journal = The FASEB Journal | volume = 1 | issue = 1 | pages = 16–21 |date=July 1987 | pmid = 3111927 | doi = 10.1096/fasebj.1.1.3111927 | doi-access = free | s2cid = 23334563 | url = http://www.fasebj.org/cgi/pmidlookup?view=long&pmid=3111927| url-access = subscription }}{{cite journal |vauthors=Krajnik M, Schäfer M, Sobanski P, etal | title = Enkephalin, its precursor, processing enzymes, and receptor as part of a local opioid network throughout the respiratory system of lung cancer patients | journal = Human Pathology | volume = 41 | issue = 5 | pages = 632–42 |date=May 2010 | pmid = 20040394 | doi = 10.1016/j.humpath.2009.08.025 }} Proenkephalin A contains four sequences of met-enkephalin (at the following positions: 100–104; 107–111; 136–140; 210–214), and as a result, its cleavage generates four copies of met-enkephalin peptides at once. In addition, anabolism of proenkephalin A results in the production of one copy each of two C-terminal-extended met-enkephalin derivatives, the heptapeptide met-enkephalin-arg-phe (261–267), and the octapeptide met-enkephalin-arg-gly-leu (186–193), though whether they affect the opioid receptors in a similar manner as met-enkephalin is not entirely clear.{{cite journal |vauthors=Vats ID, Chaudhary S, Karar J, Nath M, Pasha Q, Pasha S | title = Endogenous peptide: Met-enkephalin-Arg-Phe, differently regulate expression of opioid receptors on chronic treatment | journal = Neuropeptides | volume = 43 | issue = 5 | pages = 355–62 |date=October 2009 | pmid = 19716174 | doi = 10.1016/j.npep.2009.07.003 | s2cid = 19181608 }}

= Clearance =

Met- and leu-enkephalin are metabolized by a variety of different enzymes, including aminopeptidase N (APN),{{cite journal | vauthors = Thanawala V, Kadam VJ, Ghosh R | title = Enkephalinase inhibitors: potential agents for the management of pain | journal = Current Drug Targets | volume = 9 | issue = 10 | pages = 887–94 | date = October 2008 | pmid = 18855623 | doi = 10.2174/138945008785909356 | url = http://www.bentham-direct.org/pages/content.php?CDT/2008/00000009/00000010/0009J.SGM | archive-url = https://archive.today/20130414094722/http://www.bentham-direct.org/pages/content.php?CDT/2008/00000009/00000010/0009J.SGM | url-status = usurped | archive-date = 2013-04-14 | url-access = subscription }} neutral endopeptidase (NEP), dipeptidyl peptidase 3 (DPP3), carboxypeptidase A6 (CPA6),{{cite journal |vauthors=Lyons PJ, Callaway MB, Fricker LD | title = Characterization of carboxypeptidase A6, an extracellular matrix peptidase | journal = The Journal of Biological Chemistry | volume = 283 | issue = 11 | pages = 7054–63 |date=March 2008 | pmid = 18178555 | doi = 10.1074/jbc.M707680200 | doi-access = free }} and angiotensin-converting enzyme (ACE).{{cite journal |vauthors=Benuck M, Berg MJ, Marks N | title = Separate metabolic pathways for Leu-enkephalin and Met-enkephalin-Arg(6)-Phe(7) degradation by rat striatal synaptosomal membranes | journal = Neurochemistry International | volume = 4 | issue = 5 | pages = 389–96 | year = 1982 | pmid = 20487892 | doi = 10.1016/0197-0186(82)90081-X| s2cid = 23138078 }} These enzymes are sometimes referred to as enkephalinases.

= Biological activity =

Met-enkephalin is a potent agonist of the δ-opioid receptor, and to a lesser extent the μ-opioid receptor, with little to no effect on the κ-opioid receptor. It is through these receptors that met-enkephalin produces its opioid effects, such as analgesia and antidepressant-like effects.

It is also the endogenous ligand of the opioid growth factor receptor (OGFR; formerly known as the ζ-opioid receptor), which plays a role in the regulation of tissue growth and regeneration; hence why met-enkephalin is sometimes called OGF instead.

= Pharmacokinetics =

Met-enkephalin has low bioavailability, is rapidly metabolized, and has a very short half-life (minutes).{{cite book | author1 = William J. Kraemer | author2 = Alan David Rogol | title = The endocrine system in sports and exercise | url = https://books.google.com/books?id=TlC5Hfl04sMC&pg=PA203 | access-date = 25 November 2011 | date = 29 August 2005 | publisher = John Wiley & Sons | isbn = 978-1-4051-3017-2 | pages = 203–}} These properties are considered undesirable in pharmaceuticals as large doses would need to be administered multiple times an hour to maintain a therapeutically relevant effect, making it unlikely that met-enkephalin will ever be used as a medicine.

[D-Ala2]-Met-enkephalinamide (DALA), is a synthetic enkephalin analog which is not susceptible to degradation by brain enzymes and at low doses (5 to 10 micrograms) caused profound, long-lasting, morphine-like analgesia when microinjected into a rat’s brain.{{Cite journal|last1=Pert|first1=C. B.|last2=Pert|first2=A.|last3=Chang|first3=J. K.|last4=Fong|first4=B. T.|date=1976-10-15|title=(D-Ala2)-Met-enkephalinamide: a potent, long-lasting synthetic pentapeptide analgesic|pmid=968485|journal=Science |volume=194|issue=4262|pages=330–332|issn=0036-8075|doi=10.1126/science.968485|bibcode=1976Sci...194..330P}}

See also

References

{{Reflist|30em}}

{{Neuropeptides}}

{{Opioid receptor modulators}}

{{DEFAULTSORT:Met-enkephalin}}

Category:Opioid peptides

Category:Delta-opioid receptor agonists

Category:Pentapeptides