Metabutoxycaine
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 451224071
| IUPAC_name = 2-diethylaminoethyl 3-amino-2-butoxybenzoate
| image = Metabutoxycaine.svg
| tradename =
| pregnancy_US =
| routes_of_administration = Dental syringe (as novocaine is administered)
| bioavailability =
| metabolism = Lasts for at least 12 hours after injection.
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 3624-87-1
| PubChem = 19247
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = AMV9L2WT8K
| ChemSpiderID = 18160
| C=17 | H=28 | N=2 | O=3
| smiles = CCCCOC1=C(C=CC=C1N)C(=O)OCCN(CC)CC
| StdInChI = 1S/C17H28N2O3/c1-4-7-12-21-16-14(9-8-10-15(16)18)17(20)22-13-11-19(5-2)6-3/h8-10H,4-7,11-13,18H2,1-3H3
| StdInChIKey = LJQWYEFHNLTPBZ-UHFFFAOYSA-N
}}
Metabutoxycaine, marketed under the trade name Primacaine, is a local anesthetic. It is used in dentistry.{{cite journal |vauthors=Wang HS, Gao MS, Li S |title=[Application of primacaine in operative dentistry: analysis of clinical results] |language=zh |journal=Shanghai Kou Qiang Yi Xue = Shanghai Journal of Stomatology |volume=12 |issue=6 |pages=452, 459 |date=December 2003 |pmid=14966589 }} It has the U.S. patent number 2,882,296.Raymond O Clinton, Stanley C Laskowski, {{US patent|2882296}} (1959 to Sterling Drug Inc).