Metabutoxycaine

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 451224071

| IUPAC_name = 2-diethylaminoethyl 3-amino-2-butoxybenzoate

| image = Metabutoxycaine.svg

| tradename =

| pregnancy_US =

| routes_of_administration = Dental syringe (as novocaine is administered)

| bioavailability =

| metabolism = Lasts for at least 12 hours after injection.

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 3624-87-1

| PubChem = 19247

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = AMV9L2WT8K

| ChemSpiderID = 18160

| C=17 | H=28 | N=2 | O=3

| smiles = CCCCOC1=C(C=CC=C1N)C(=O)OCCN(CC)CC

| StdInChI = 1S/C17H28N2O3/c1-4-7-12-21-16-14(9-8-10-15(16)18)17(20)22-13-11-19(5-2)6-3/h8-10H,4-7,11-13,18H2,1-3H3

| StdInChIKey = LJQWYEFHNLTPBZ-UHFFFAOYSA-N

}}

Metabutoxycaine, marketed under the trade name Primacaine, is a local anesthetic. It is used in dentistry.{{cite journal |vauthors=Wang HS, Gao MS, Li S |title=[Application of primacaine in operative dentistry: analysis of clinical results] |language=zh |journal=Shanghai Kou Qiang Yi Xue = Shanghai Journal of Stomatology |volume=12 |issue=6 |pages=452, 459 |date=December 2003 |pmid=14966589 }} It has the U.S. patent number 2,882,296.Raymond O Clinton, Stanley C Laskowski, {{US patent|2882296}} (1959 to Sterling Drug Inc).